Tài liệu, ebook Hóa Học

Strength of the nucleophile determines order: Strong nucleophiles or bases promote bimolecular reactions. Primary halide usually undergo SN2. Tertiary halide mixture of SN1, E1 or E2. They cannot undergo SN2. High temperature favors elimination. Bulky bases favor elimination.

61 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 791 | Lượt tải: 0

when the solute-to-solvent attractions are weaker than the sum of the solute-to-solute and solvent-to-solvent attractions, the solution will only form if the energy difference is small enough to be overcome by the entropy

13 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 779 | Lượt tải: 0

Diastereomers have different physical properties, so they can be easily separated. Enantiomers differ only in reaction with other chiral molecules and the direction in which polarized light is rotated. Enantiomers are difficult to separate. Convert enantiomers into diastereomers to be able to separate them.

48 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 795 | Lượt tải: 0

A strong base can abstract a proton from tribromomethane (CHBr3) to give an inductively stabilized carbanion. This carbanion expels bromide ion to give dibromocarbene. The carbon atom is sp2 hybridized with trigonal geometry. A carbene has both a lone pair of electrons and an empty p orbital, so it can react as a nucleophile or as an electroph...

54 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 851 | Lượt tải: 0

(c) The trans isomer is more stable. The most stable conformation of the trans isomer is diequatorial and therefore about 7.6 kJ/mol (1.8 kcal/mol) lower in energy than either conformation of the cis isomer, each having one methyl axial and one equatorial. Remember that cis and trans are distinct isomers and cannot interconvert.

62 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 823 | Lượt tải: 0

Alkanes: Single bonds between the carbons; all carbons are sp3. Cycloalkanes: sp3 carbons form a ring. Alkenes: Double bonds are present in the molecule; sp2 carbons. Cycloalkenes: Double bond in a ring. Alkynes: Triple bonds are present; sp carbons Aromatic: Contain a benzene ring.

46 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 756 | Lượt tải: 0

Nucleophile: Donates electrons to a nucleus with an empty orbital. Electrophile: Accepts a pair of electrons. When forming a bond, the nucleophile attacks the electrophile, so the arrow goes from negative to positive. When breaking a bond, the more electronegative atom receives the electrons.

43 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 846 | Lượt tải: 0

Phủ nhúng (Dip Coating) Đế được nhúng vào dung dịch sol, sau đó được kéo ra từ từ → màng/đế Chúng tôi đã dịch được một số chương của một số khóa học thuộc chương trình học liệu mở của hai trường đại học nổi tiếng thế giới MIT và Yale.

32 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 814 | Lượt tải: 0

Natri lauryl ether sulfate (SLES), hoặc sodium laureth sulfate, là một chất hoạt động bề mặt anion, được tìm thấy trong nhiều sản phẩm chăm sóc cá nhân (xà phòng, dầu gội, kem đánh răng, vv.) SLES là một chất tạo bọt rất hiệu quả. Công thức hóa học của nó là CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Đôi khi số đại diện bởi n được quy định trong tên, cho ...

10 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 1000 | Lượt tải: 0

Ph-ơng trình hồi qui tổng quát của mô hình tìm đ-ợc bằng ph-ơng pháp mạng đơn hình có dạng: Ma trận của mạng đơn hình, luôn tuân theo tính chất: 1/ Tổng thành phần của các cấu tử trong hỗn hợp bằng 1. 2/ Mỗi đỉnh trong mạng đơn hình t-ơng ứng với 1 hỗn hợp có thành phần xác định. Hỗn hợp có thành phần theo đỉnh t-ơng ứng sẽ cho một tính chất x...

5 trang | Chia sẻ: nguyenlam99 | Ngày: 10/01/2019 | Lượt xem: 813 | Lượt tải: 0