Một số phản ứng hóa học cơ bản lớp 12

116. Sn + O2 SnO2. 117. 118. Ag + 2HNO3(đặc) AgNO3 + NO2 + H2O. 119. 2Ag + 2H2S + O2 2Ag2S + 2H2O. 120. 2Ag + O3 Ag2O + O2. 121. Ag2O + H2O2 2Ag + H2O + O2. 122. 2AgNO3 2Ag + 2NO2 + O2. 123. 4AgNO3 + 2H2O 4Ag + 4HNO3 + O2. 124. Au +HNO3 + 3HCl AuCl3 + 2H2O + NO.

doc12 trang | Chia sẻ: phuongdinh47 | Lượt xem: 17802 | Lượt tải: 3download
Bạn đang xem nội dung tài liệu Một số phản ứng hóa học cơ bản lớp 12, để tải tài liệu về máy bạn click vào nút DOWNLOAD ở trên
MỘT SỐ PHẢN ỨNG HÓA HỌC CƠ BẢN LỚP 12 CHƯƠNG I. ESTE – LIPIT Một số trường hợp thuỷ phân đặc biệt của este (không chứa halogen) thường gặp trong bài toán định lượng là : · Este + NaOH 1 muối + 1 anđehit Este đơn chức có gốc ancol dạng công thức R-CH=CH- Thí dụ CH3COOCH=CH-CH3 · Este + NaOH 1 muối + 1 xeton Este đơn chức với dạng công thức R’ –COO – C(R)=C(R”)R’’’ Thí dụ : CH3-COO-C(CH3)= CH2 tạo axeton khi thuỷ phân. · Este + NaOH 1 muối + 1 ancol + H2O Este- axit : HOOC-R-COOR’ · Este + NaOH 2 muối + H2O Este của phenol: C6H5OOC-R · Este + NaOH 1 muối + anđehit + H2O Hiđroxi- este: RCOOCH(OH)-R’ · Este + NaOH 1 muối + xeton + H2O Hiđroxi- este: RCOOC(R)(OH)-R’ · Este + NaOH 1 sản phẩm duy nhất hoặc “m RẮN = mESTE + mNaOH”. Este vòng (được tạo bởi hiđroxi axit) · Este + NaOH Có MSP = MEste + MNaOH Đây chính là este vòng nhưng được nhìn dưới góc độ khác mà thôi MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. RCOOCH=CH2 + NaOH RCOONa + CH3CHO 2. RCOOC6H5 + 2NaOH RCOONa + C6H5ONa + H2O 3. C3H5(OOC)3 + 3NaOH 3COONa + C3H5(OH)3 4. bR(COOH)a + aR'(OH)b Rb(COO)abR'a + abH2O 5. (C17H35COO)3C3H5 + 3KOH C17H35COOK + C3H5(OH)3 6. 3CH3COOH + PCl3 ® 3CH3COCl + H3PO3 7. 3CH3COOH + POCl3 3CH3COCl + H3PO4 8. CH3COONa(r) + NaOH(r) CH4 + Na2CO3 9. CH3CH2COOH + Br2 CH3CHBrCOOH + HBr 10. CH3-CO-CH3 + HCN ® (CH3)2C(OH)CN 11. (CH3)2C(OH)CN + 2H2O ® (CH3)2C(OH)COOH + NH3­ 12. R-Cl + KCN ® R-CN + KCl 13. R-CN + 2H2O ® R-COOH + NH3­ 14. C6H5-CH(CH3)2 C6H5OH + CH3COCH3 15. RCOONa + HCl (dd loãng) ® RCOOH + NaCl 16. 2CH3COONa(r) + 4O2 Na2CO3 + 3CO2­ + 3H2O 17. CxHy(COOM)a + O2 M2CO3 + CO2 + H2O (sơ đồ phản ứng đốt cháy muối cacboxylat). 18. RCOOC(CH3)=CH2 + NaOH RCOONa + CH3COCH3 CHƯƠNG II. CACBOHIĐRAT MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1.CH2OH[CHOH]4CHO+5CH3COOH CH3COOCH2[CHOOCCH3]4CHO + H2O (pentaaxetyl glucozơ) 2. CH2OH[CHOH]4CHO + H2CH2OH[CHOH]4CH2OH Sobit (Sobitol) 3. CH2OH[CHOH]4CHO + 2Cu(OH)2 CH2OH[CHOH]4COOH + Cu2O¯ + 2H2O 4. glucozơ amoni gluconat 5. C6H12O6 2C2H5OH + 2CO2­ 6. C6H12O6 2CH3–CHOH–COOH Axit lactic (axit sữa chua) 7. (C6H10O5)n + nH2O nC6H12O6 (Tinh bột) (Glucozơ) 8. (C6H10O5)n + nH2O nC6H12O6 (Xenlulozơ) (Glucozơ) 9. 6H–CHO C6H12O6 10. metyl a-glucozit 11. CH2OH[CHOH]3COCH2OH CH2OH[CHOH]4CHO 12. CH2OH[CHOH]4CHO + Br2 + H2O CH2OH[CHOH]4COOH + 2HBr 13. CH2OH[CHOH]4COOH + Fe3+ tạo phức màu vàng xanh. 14. C12H22O11 + H2OC6H12O6(Glucozơ) + C6H12O6(Fructozơ) 15. C12H22O11 + Ca(OH)2 + H2O C12H22O11.CaO.2H2O 16. C12H22O11.CaO.2H2O + CO2C12H22O11 + CaCO3¯+ 2H2O 17. (C6H10O5)n + nH2O nC6H12O6 tinh bột glucozơ 18. 6nCO2 + 5nH2O (C6H10O5)n 19. (C6H10O5)n + nH2O nC6H12O6 xenlulozơ glucozơ 20. [C6H7O2(OH)3]n + 3nHONO2 [C6H7O2(ONO2)3]n + 3nH2O (HNO3) xenlulozơ trinitrat CHƯƠNG III. AMIN – AMINO AXIT – PROTEIN MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. C2H5–NH2 + HONOC2H5–OH + N2­ + H2O 2. C6H5–NH2+HONO+HCl+2H2O 3. + H2O C6H5OH + N2­+ HCl 4. R(R’)N – H +HO – N=OR(R’)N – N =O + H2O (nitroso – màu vàng) 5. CH3 – NH2 + H2O CH3 – NH3+ + OH- 6. CH3NH2 + H–COOH H–COONH3CH3 metylamoni fomiat 7. C6H5NH2 + HCl C6H5NH3Cl phenylamoni clorua 8. CH3NH3Cl + NaOH CH3NH2 + NaCl + H2O 9. C6H5NH2 + CH3COOH CH3COONH3C6H5 10. C6H5NH2 + H2SO4 C6H5NH3HSO4 11. 2C6H5NH2 + H2SO4 [C6H5NH3]2SO4 12. 13. 14. R–NO2 + 6 R–NH2 + 2H2O 15. C6H5–NO2 + 6 C6H5–NH2 + 2H2O Cũng có thể viết: 16. R–NO2 + 6HCl + 3FeR–NH2 + 3FeCl2 + 2H2O 17. R – OH + NH3R–NH2 + H2O 18. 2R – OH + NH3 (R)2NH + 2H2O 19. 3R – OH + NH3 (R)3N + 3H2O 20. R – Cl + NH3 R – NH2 + HCl 21. R – NH2 + HCl R – NH3Cl 22. R – Cl + NH3 R – NH3Cl 23. R – NH3Cl + NaOH R – NH2 + NaCl + H2O 24. 2R – Cl + NH3 (R)2NH + 2HCl 25. 3R – Cl + NH3 (R)3N + 3HCl 26. H2N–R–COOH H2N–R–COO- + H+ H3N+–R – COO- 27. H2NR(COOH)a + aNaOH H2N(COONa)a + aH2O 28. 2(H2N)bR(COOH)a + aBa(OH)2 [(H2N)bR(COO)a]2Baa + 2aH2O 29. H2N–R–COOH + NaH2N–R–COONa + H2 30. (H2N)b R (COOH)a + aNa (H2N)bR(COONa)a + H2 31. 2(H2N)bR(COOH)a + aNa2O 2(H2N)b R(COONa)a + aH2O 32. H2N–R–COOH + R’–OH H2N–R–COOR’ + H2O 33. H2N–R–COOH + R’–OH + HCl [H3N+–R–COOR’]Cl- + H2O 34. [H3N+–R–COOR’]Cl- + NH3 H2N–R–COOR’ + NH4Cl 35. H2N–R–COOH + HCl ClH3N–R–COOH 36. 2(H2N)bR(COOH)a + bH2SO4 [(H3N)bR(COOH)a]2(SO4)b 37. ClH3N–R–COOH + 2NaOH H2N–R–COONa + NaCl + H2O 38. H2N–R–COOH + HONO HO–R–COOH + N2­ + H2O 39. 40. 41. CH3CH(Br)COOH + 3NH3 CH3CH(NH2)COONH4 + NH4Br CHƯƠNG IV. POLIME MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. Nhựa a) Nhựa PE b) Nhựa PVC c) Nhựa PS d) Nhựa PVA Thuỷ phân PVA trong môi trường kiềm: e) Nhựa PMM (thuỷ tinh hữu cơ - plexiglas) f) Nhựa PPF Poli(phenol - fomanđehit) (PPF) có 3 dạng: nhựa novolac, nhựa rezol, nhựa rezit. - Nhựa novolac: Nếu dư phenol và xúc tác axit. - Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. - Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. 2. Cao su a) Cao su buna nCH2=CH-CH=CH2 buta-1,3-đien (butađien) polibutađien (cao su buna) b) Cao su isopren c) Cao su buna – S d) Cao su buna – N e) Cao su clopren f) Cao su flopren 3. Tơ a) Tơ capron (nilon – 6) b) Tơ enang (nilon – 7) c) Tơ nilon – 6,6) d) Tơ clorin e) Tơ dacron (lapsan) CHƯƠNG V. ĐẠI CƯƠNG VỀ KIM LOẠI MỘT SỐ PHẢN ỨNG THƯỜNG GẶP 1. 2Fe + 3Cl2 2FeCl3 2. Fe + S FeS 3. 3Fe + 2O2 Fe3O4 4. Fe + 2HCl FeCl2 + H2 5. Fe + 4HNO3 Fe(NO3)3 + NO + 2H2O 6. Fe + H2O FeO + H2 7. Na + H2O NaOH + H2 8. Ba + 2H2O Ba(OH)2 + H2 9. Fe + CuSO4 FeSO4 + Cu 10. 2FeCl3 + Fe 3FeCl2 11. Fe2(SO4)3 + Cu CuSO4 + 2FeSO4 12. Fe + 2AgNO3 Fe(NO3)2 + 2Ag 13. Fe + 3AgNO3, dư Fe(NO3)3 + 3Ag 14. H2 + PbO H2O + Pb 15. Fe2O3 + 3CO 2Fe + 3CO2 16. 3Fe3O4 + 8Al 4Al2O3 + 9Fe 17. Al2O3 2Al + O2 18. 2NaCl 2 Na + Cl2 19. 2NaOH 2Na + O2 + H2O 20. MgCl2 Mg + Cl2 23. CuCl2 Cu + Cl2 24. CuSO4 + H2O Cu + O2 + H2SO4 25. 2AgNO3 + H2O 2Ag + O2 + 2HNO3 26. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 CHƯƠNG VI. KIM LOẠI KIỀM, KIM LOẠI KIỀM THỔ VÀ NHÔM MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. 2Na + O2 Na2O 2. Mg + O2 MgO 3. 2Al + O2 Al2O3 4. K + Cl2 KCl 5. Ca + Cl2 CaCl2 6. Al + Cl2 AlCl3 7. Na + HCl → NaCl + H2 8. Mg + 2HCl → MgCl2 + H2 9. Al + 3HCl → AlCl3 + H2 10. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O 11. Al + 4HNO3 đặc Al(NO3)3 + NO + 2H2O 12. 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O 13. 2Al + 6H2SO4 đặc Al2(SO4)3 + 3SO2 + 6H2O 14. 2K + 2H2O → 2KOH + H2 15. Ca + 2H2O → Ca(OH)2 + H2 16. 2Al + 6H2O → 2Al(OH)3 + 3H2 17. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. Mg + CuSO4 → MgSO4 + Cu 19. 2Al + Fe2O3 Al2O3 + 2Fe 20. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 21. 2NaCl 2Na + Cl2 22. 2NaOH 2Na + O2 + H2O 23. MgCl2 Mg + Cl2 24. 2Al2O3 4Al + 3O2 25. 2NaCl + 2H2O 2NaOH + H2 + Cl2 26. NaOH + CO2 → NaHCO3 27. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. 2NaOH + CO2 → Na2CO3 + H2O 29. Ca(OH)2 + CO2 → CaCO3 + H2O 30. NaOH + HCl → NaCl + H2O 31. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2¯ 32. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 33. 2NaHCO3 Na2CO3 + CO2­ + H2O 34. Ca(HCO3)2 CaCO3 + CO2­ + H2O 35. Mg(HCO3)2 MgCO3 + CO2­ + H2O 36. NaHCO3 + HCl → NaCl + CO2­ + H2O 37. NaHCO3 + NaOH → Na2CO3 + H2O 38. Na2CO3 + 2HCl → 2NaCl + H2O + CO2­ 39. CaCO3 + 2HCl → CaCl2 + H2O + CO2­ 40. CaCO3 + H2O + CO2 Ca(HCO3)2 41. CaCO3 CaO + CO2 42. 2KNO3 2KNO2 + O2 43. 2KNO3 + 3C + S N2 + 3CO2 + K2S 44. Ca(NO3)2 Ca(NO2)2 + O2 45. 2Mg(NO3)2 2MgO + 4NO2 + O2 46. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. Mg2+ + HPO42- + NH3 → MgNH4PO4 ↓ (màu trắng) 50. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. Al(OH)3 + NaOH → Na[Al(OH)4] 54. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl 55. 2Al(OH)3 Al2O3 + 3H2O CHƯƠNG VII. CROM - SẮT - ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Crom - Sắt - Đồng - Cấu hình electron nguyên tử Cr : [Ar]3d54s1; Fe : [Ar]3d64s2, Cu : [Ar]3d104s1. - Thế điện cực chuẩn = -0,74V; = -0,44V; = 0,77V, = 0,34V. 2. Sơ đồ minh hoạ tính chất hoá học của crom + O2, t0 Cr2O3 (r) + NH3 CrO3 + bột Al Nước + Cl2, t0 CrCl3 (r) H2CrO4 H2Cr2O7 Cr HCl Cr+2(dd) + Cl2 Cr+3 (dd) +Br2 Cr+6 (dd) H2SO4(l) +Zn +SO2, KI Kiềm Axit Axit Cr(OH)2 +(O2+H2O) Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 Số oxi hoá +3 Số oxi hoá +6 - Tính khử. - Tính khử và tính oxi hoá. - Tính oxi hoá. - Oxit và hiđroxit có tính bazơ. - Oxit và hiđroxit có tính lưỡng tính. - Oxit và hiđroxit có tính axit. 3. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 Số oxi hoá +3 - Tính khử. - Tính oxi hoá. - Oxit và hiđroxit có tính bazơ. - Oxit và hiđroxit có tính bazơ. 4. Sơ đồ minh hoạ tính chất hoá học đồng Cu Không khí, t0 [Cu(NH3)4]2+ H+ OH- NH3 HCl + O2, HNO3, H2SO4 đ CuCl2 (r) Cu(OH)2 Cu2+ (dd) CuO (đen) dd FeCl3, AgNO3 CuSO4.5H2O Cu(NO3)2.3H2O H+ Kết tinh Không khí, 10000C Cu2O (đỏ) t0 CuCO3.Cu(OH)2 (r) Chất khử CO, NH3, t0 Không khi ẩm Khí Clo khô Số oxi hoá +2 - Tính oxi hoá. - Oxit và hiđroxit có tính bazơ. 5. Sơ lược về các kim loại Ag, Au, Ni, Zn, Sn, Pb Ag Au Ni Zn Sn Pb Số oxi hoá +1, (+2) +1, +3 +2, (+3) +2 +2, +4 +2, +4 Eo(V) Ag+/Ag +0,08 Au3+/Au +1,5 Ni2+/Ni -0,26 Zn2+/Zn -0,76 Sn2+/Sn -0,14 Pb2+/Pb -0,13 Tính khử Rất yếu Rất yếu T.Bình Mạnh Yếu Yếu B - MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) 1. Fe + S FeS. 2. 3Fe + 2O2 Fe3O4. 3. 2Fe + 3Cl2 2FeCl3. 4. Fe + 2HCl FeCl2 + H2. 5. Fe + H2SO4 loãng FeSO4 + H2. 6. 2Fe + 6H2SO4 đặc Fe2(SO4)3 + 3SO2 + 6H2O. 7. Fe + 4HNO3 loãng Fe(NO3)3 + NO + 2H2O. 8. Fe + 6HNO3 đặc Fe(NO3)3 + 3NO2 + 3H2O. 9. Fe (dư) + HNO3 Fe(NO3)2 + ..... 10. Fe (dư) + H2SO4 (đặc) FeSO4 + ..... 11. Fe + CuSO4 FeSO4 + Cu. 12. Fe + 2AgNO3 Fe(NO3)2 + 2Ag. 13. Fe + 3AgNO3 (dư) Fe(NO3)3 + .... 14. 3Fe + 4H2O Fe3O4 + 4H2. 15. Fe + H2O FeO + H2. 16. 3FeO + 10HNO3 đặc 3Fe(NO3)3 + NO + 5H2O. 17. 2FeO + 4H2SO4 đặc Fe2(SO4)3 + SO2 + 4H2O. 18. FeO + H2SO4 loãng FeSO4 + H2O. 19. FeO + 2HCl FeCl2 + H2O. 20. FeO + CO Fe + CO2. 21. Fe(OH)2 + 2HCl FeCl2 + 2H2O. 22. Fe(OH)2 + H2SO4 FeSO4 + 2H2O. 23. 4Fe(OH)2 + O2 + 2H2O 4Fe(OH)3. 24. FeCl2 + 2NaOH Fe(OH)2 + 2NaCl. 25. 2FeCl2 + Cl2 2FeCl3. 26. 10FeSO4 + 2KMnO4 + 8H2SO4 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. 27. 3Fe2O3 + CO 2Fe3O4 + CO2. 28. Fe2O3 + CO 2FeO + CO2. 29. Fe2O3 + 3CO 2Fe + 3CO2. 30. Fe2O3 + 3H2SO4 loãng Fe2(SO4)3 + 3H2O. 31. Fe2O3 + 6HCl 2FeCl3 + 3H2O. 32. Fe2O3 + 3H2SO4 Fe2(SO4)3 + 3H2O. 33. FeCl3 + 3NaOH Fe(OH)3 + 3NaCl. 34. 2FeCl3 + Fe 3FeCl2. 35. 2FeCl3 + Cu 2FeCl2 + CuCl2. 36. 2FeCl3 + 2KI 2FeCl2 + 2KCl + I2. 37. 2Fe(OH)3 Fe2O3 + 3H2O. 38. 2Fe(OH)3 + 3H2SO4 Fe2(SO4)3 + 6H2O. 39. Fe(OH)3 + 3HCl FeCl3 + 3H2O. 40. 2FeS2 + 14H2SO4 Fe2(SO4)3 + 15SO2 + 14H2O. 41. 4FeS2 + 11O2 2Fe2O3 + 8SO2. 42. 4Cr + 3O2 2Cr2O3. 43. 2Cr + 3Cl2 2CrCl3. 44. 2Cr + 3S Cr2S3. 45. Cr + 2HCl CrCl2 + H2. 46. Cr + H2SO4 CrSO4 + H2. 47. 2Cr + 3SnCl2 2CrCl3 + 3Sn. 48. 4Cr(OH)2 + O2 + 2H2O 4Cr(OH)3. 49. Cr(OH)2 + 2HCl CrCl2 + 2H2O. 50. Cr(OH)3 + NaOH Na[Cr(OH)4] (hay NaCrO2). 51. Cr(OH)3 + 3HCl CrCl3 + 3H2O. 52. 2Cr(OH)3 Cr2O3 + 3H2O. 53. 2CrO + O2 2Cr2O3. 54. CrO + 2HCl CrCl2 + H2O. 55. Cr2O3 + 3H2SO4 Cr2(SO4)3 + 3H2O. 56. 2Cr2O3 + 8NaOH + 3O2 4Na2CrO4 + 4H2O. 57. Cr2O3 + 2Al 2Cr + Al2O3. 58. CrO3 + H2O H2CrO4. 59. 2CrO3 + H2O H2Cr2O7. 60. 4CrO3 2Cr2O3 + 3O2. 61. 2CrO3 + 2NH3 Cr2O3 + N2 + 3H2O. 62. 4CrCl2 + O2 + 4HCl 4CrCl3 + 2H2O. 63. CrCl2 + 2NaOH Cr(OH)2 + 2NaCl. 64. 2CrCl2 + Cl2 2CrCl3. 65. 2CrCl3 + Zn ZnCl2 + 2CrCl2. 66. CrCl3 + 3NaOH Cr(OH)3 + 3NaCl. 67. 2CrCl3 + 3Cl2 + 16NaOH 2Na2CrO4 + 12NaCl + 8H2O. 68. 2NaCrO2 + 3Br2 + 8NaOH 2Na2CrO4 + 6NaBr +4H2O 69. 2Na2Cr2O7 + 3C 2Na2CO3 + CO2 + 2Cr2O3. 70. Na2Cr2O7 + S Na2SO4 + Cr2O3. 71. Na2Cr2O7 + 14HCl 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 72. K2Cr2O7 + 3H2S + 4H2SO4 Cr2(SO4)3 +3S + K2SO4 + 7H2O. 73. K2Cr2O7 + 3K2SO3 + 4H2SO4 Cr2(SO4)3 + 4K2SO4 + 4H2O. 74. K2Cr2O7+6KI+7H2SO4 Cr2(SO4)3+4K2SO4+3I2+7H2O. 75. K2Cr2O7 + 6FeSO4 + 7H2SO4 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. 76. (NH4)2Cr2O7 Cr2O3 + N2 + 4H2O. 77. 2Na2Cr2O7 2Na2O + 2Cr2O3 + 3O2. 78. 2Na2CrO4 + H2SO4 Na2Cr2O7 + Na2SO4 + H2O. 79. Cu + Cl2 CuCl2. 80. 2Cu + O2 2CuO. 81. Cu + S CuS. 82. Cu + 2H2SO4 đặc CuSO4 + SO2 + 2H2O. 83. Cu + 4HNO3 đặc Cu(NO3)2 + 2NO2 + 2H2O. 84. 3Cu + 8HNO3 loãng 3Cu(NO3)2 + 2NO + 4H2O. 85. Cu + 2AgNO3 Cu(NO3)2 + 2Ag. 86. Cu + 2FeCl3 CuCl2 + 2FeCl2. 87. 3Cu + 8NaNO3 + 4H2SO4 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. 88. 2Cu + 4HCl + O2 2CuCl2 + 2H2O. 89. CuO + H2SO4 CuSO4 + H2O. 90. CuO + 2HCl CuCl2 + H2O. 91. CuO + H2 Cu + H2O. 92. CuO + CO Cu + CO2. 93. 3CuO + 2NH3 N2 + 3Cu + 3H2O. 94. CuO + Cu Cu2O. 95. Cu2O + H2SO4 loãng CuSO4 + Cu + H2O. 96. Cu(OH)2 + 2HCl CuCl2 + 2H2O. 97. Cu(OH)2 + H2SO4 CuSO4 + 2H2O. 98. Cu(OH)2 CuO + H2O. 99. Cu(OH)2 + 4NH3 [Cu(NH3)4]2+ + 2OH-. 100. 2Cu(NO3)2 2CuO + 2NO2 + 3O2. 101. CuCl2 Cu + Cl2. 102. 2Cu(NO3)2 + 2H2O 2Cu + 4HNO3 + O2. 103. 2CuSO4 + 2H2O 2Cu + 2H2SO4 + O2. 104. CuCO3.Cu(OH)2 2CuO + CO2 + H2O. 105. CuS + 2AgNO3 2AgS + Cu(NO3)2. 106. CuS + 4H2SO4 đặc CuSO4 + 4SO2 + 4H2O. 107. 2Ni + O2 2NiO. 108. Ni + Cl2 NiCl2. 109. Zn + O2 2ZnO. 110. Zn + S ZnS. 111. Zn + Cl2 ZnCl2. 112. 2Pb + O2 2PbO. 113. Pb + S PbS. 114. 3Pb + 8HNO3 loãng 3Pb(NO3)2 + 2NO + 4H2O. 115. Sn + 2HCl SnCl2 + H2. 116. Sn + O2 SnO2. 117. 118. Ag + 2HNO3(đặc) AgNO3 + NO2 + H2O. 119. 2Ag + 2H2S + O2 2Ag2S + 2H2O. 120. 2Ag + O3 Ag2O + O2. 121. Ag2O + H2O2 2Ag + H2O + O2. 122. 2AgNO3 2Ag + 2NO2 + O2. 123. 4AgNO3 + 2H2O 4Ag + 4HNO3 + O2. 124. Au +HNO3 + 3HCl AuCl3 + 2H2O + NO.

Các file đính kèm theo tài liệu này:

  • docphan_ung_co_ban_thpt_8468.doc
Tài liệu liên quan