Một số kiến thức hóa học cơ bản Lớp 12

Đồng là kim loại dẻo có độ dẫn điện và dẫn nhiệt cao. Đồng nguyên chất mềm và dễ uốn; bề mặt đồng tươi có màu cam đỏ. Nó được sử dụng làm chất dẫn nhiệt và điện, vật liệu xây dựng, và thành phần của các hợp kim của nhiều kim loại khác nhau. Kim loại và các hợp kim của nó đã được sử dụng cách đây hàng ngàn năm. Trong thời kỳ La Mã, đồng chủ yếu được khai thác ởSíp, vì thế tên gọi ban đầu của kim loại này là сyprium (kim loại Síp), sau đó được gọi tắt là сuprum. Các hợp chất của nó thường tồn tại ở dạng muối đồng(II), chúng thường có màu xanh lam hoặc xanh lục của các loại khoáng như ngọc lam và trong lịch sử đã được sử dụng rộng rãi làm chất nhuộm. Các công trình kiến trúc được xây dựng có đồng bị ăn mòn tạo ra màu xanh lục verdigris(hoặc patina). Trái ngược với các kim loại mà phân lớp d không được lấp đầu bởi các electron, các liên kết kim loại trong đồng thiếu các đặc điểm của liên kết cộng hóa trị và chúng tương đối yếu. Điều này giải thích tại sao các tinh thể đồng riêng biệt có độ dẻo cao và độ cứng thấp.[1] Ở quy mô lớn, việc thêm vào các khuyết tật trong ô mạng tinh thể như ranh giới hạt, sẽ làm cản trở dòng vật liệu dưới áp lực nén từ đó làm tăng độ cứng của nó

doc32 trang | Chia sẻ: phuongdinh47 | Ngày: 03/03/2016 | Lượt xem: 1144 | Lượt tải: 2download
Bạn đang xem trước 20 trang tài liệu Một số kiến thức hóa học cơ bản Lớp 12, để xem tài liệu hoàn chỉnh bạn click vào nút DOWNLOAD ở trên
6H5)2NH + Tác dụng với axit: RNH2 + HCl → RNH3Cl + Phản ứng thế brom của anilin : C6H5NH2 + 3Br2 → C6H2Br3NH2 ↓ trắng + 3HBr M= 93 M=330 C6H5OH + 3Br2 → C6H2Br3OH ↓ trắng + 3HBr M= 94 M=331 + Phản ứng cháy: CnH2n+3N + O2 → n CO2 + H2O + N2 II.AMINOAXIT 1. Khái niệm: hchc tạp chức, phân tử chứa đồng thời nhóm amino (-NH2) và nhóm cacboxyl (-COOH) 2. CTC của aminoaxit no, đơn chức: H2N-CnH2n-COOH hay CnH2n+1NO2 CTC của Aminoaxit : (H2N)a -R-(COOH)b 3. Đồng phân: CTPT Số đồng phân C2H7NO2 1 C3H7NO2 2 C4H9NO2 5 4. Tên gọi : Công thức Tên thay thế Tên bán hệ thống Tên thường Kí hiệu Axit aminoetanoic Axit aminoaxetic Glyxin Gly Axit 2-aminopropanoic Axit a-aminopropionic Alanin Ala Axit 2-amino-3-metylbutanoic Axit a-aminoisovaleric Valin Val Axit 2-aminopentan-1,5-đioic Axit a-aminoglutaric Axit glutamic Glu Axit 2,6-điamino hexanoic Axit điaminocaproic Lysin Lys Tính chất vật lí: chất rắn kết tinh, dễ tan trong nước, nhiệt độ nóng chảy cao. Cấu tạo: thường tồn tại dạng ion lưỡng cực H2N-R-COOH Tính chất hóa học: + Tính axit – bazơ: (NH2)b - R - (COOH)a a > b à quỳ tím hóa đỏ Nếu a = b à quỳ tím không đổi màu a < b à quỳ tím hóa xanh. + Tính lưỡng tính: vừa tác dụng với axit (HCl) vừa tác dụng với bazơ (NaOH, KOH) H2N-R-COOH + NaOH → H2N-R-COONa + H2O H2N-R-COOH + HCl → ClH3N-R-COOH ( hay HOOC-R-NH3Cl) + Phản ứng riêng của nhóm COOH: T/d với kim loại đứng trước H2, oxit bazơ, bazơ, ancol (xt HCl) + Phản ứng trùng ngưng: polime thuộc loại poli amit Ví dụ: (-HN-[CH2]5-CO-)n : tơ capron (nilon-6) (-HN-[CH2]6-CO-)n : tơ enang (nilon-7) III.PEPTIT VÀ PROTEIN 1. Khái niệm peptit: chứa 2-50 gốc α-aminoaxit. Liên kết peptit là liên kết CO-NH giữa 2 α-aminoaxit 2. Khái niêm protein: poli peptit cao phân tử (có dạng dd keo và bị đông tụ khi đun nóng) 3. Tính chất hóa học của peptit và protein: + Phản ứng thủy phân: peptit (protein) chuỗi polipeptit α-aminoaxit + Phản ứng màu biure: Peptit ; protein (lòng trắng trứng) + Cu(OH)2 → màu tím Riêng : protein (lòng trắng trứng) + HNO3 → kết tủa vàng 4. Chú ý: nếu phân tử peptit có n gốc aminoaxit khác nhau thì + số đồng phân peptit là: n ! + Số đipeptit tối đa : n2 + số liên kết peptit là : n – 1 + Số tripeptit tối đa : n3 LƯU Ý: Amin TT CTPT Số đồng phân Bậc Bậc1 Bậc 2 Bậc 3 1 C2H7N 2 1 1 2 C3H9N 4 2 1 1 3 C4H11N 8 4 3 1 4 C6H7N 1 5 C7H9N 5 Amino axit : TT CTPT Số đồng phân 1 C2H7NO2 1 2 C3H7NO2 2 3 C4H9NO2 5 MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. C2H5–NH2 + HONOC2H5–OH + N2­ + H2O 2. C6H5–NH2+HONO+HCl+2H2O 3. + H2O C6H5OH + N2­+ HCl 4. R(R’)N – H +HO – N=OR(R’)N – N =O + H2O (nitroso – màu vàng) 5. CH3 – NH2 + H2O CH3 – NH3+ + OH- 6. CH3NH2 + H–COOH H–COONH3CH3 metylamoni fomiat 7. C6H5NH2 + HCl C6H5NH3Cl phenylamoni clorua 8. CH3NH3Cl + NaOH CH3NH2 + NaCl + H2O 9. C6H5NH2 + CH3COOH CH3COONH3C6H5 10. C6H5NH2 + H2SO4 C6H5NH3HSO4 11. 2C6H5NH2 + H2SO4 [C6H5NH3]2SO4 12. 13. 14. R–NO2 + 6 R–NH2 + 2H2O 15. C6H5–NO2 + 6 C6H5–NH2 + 2H2O Cũng có thể viết: 16. R–NO2 + 6HCl + 3FeR–NH2 + 3FeCl2 + 2H2O 17. R – OH + NH3R–NH2 + H2O 18. 2R – OH + NH3 (R)2NH + 2H2O 19. 3R – OH + NH3 (R)3N + 3H2O 20. R – Cl + NH3 R – NH2 + HCl 21. R – NH2 + HCl R – NH3Cl 22. R – Cl + NH3 R – NH3Cl 23. R – NH3Cl + NaOH R – NH2 + NaCl + H2O 24. 2R – Cl + NH3 (R)2NH + 2HCl 25. 3R – Cl + NH3 (R)3N + 3HCl 26. H2N–R–COOH H2N–R–COO- + H+ H3N+–R – COO- 27. H2NR(COOH)a + aNaOH H2N(COONa)a + aH2O 28. 2(H2N)bR(COOH)a + aBa(OH)2 [(H2N)bR(COO)a]2Baa + 2aH2O 29. H2N–R–COOH + NaH2N–R–COONa + H2 30. (H2N)b R (COOH)a + aNa (H2N)bR(COONa)a + H2 31. 2(H2N)bR(COOH)a + aNa2O 2(H2N)b R(COONa)a + aH2O 32. H2N–R–COOH + R’–OH H2N–R–COOR’ + H2O 33. H2N–R–COOH + R’–OH + HCl [H3N+–R–COOR’]Cl- + H2O 34. [H3N+–R–COOR’]Cl- + NH3 H2N–R–COOR’ + NH4Cl 35. H2N–R–COOH + HCl ClH3N–R–COOH 36. 2(H2N)bR(COOH)a + bH2SO4 [(H3N)bR(COOH)a]2(SO4)b 37. ClH3N–R–COOH + 2NaOH H2N–R–COONa + NaCl + H2O 38. H2N–R–COOH + HONO HO–R–COOH + N2­ + H2O 39. 40. 41. CH3CH(Br)COOH + 3NH3 CH3CH(NH2)COONH4 + NH4Br CHƯƠNG IV. POLIME I.Phương pháp điều chế polime: Phản ứng Khái niệm Điều kiện Ví dụ Trùng hợp Qúa trình liên kết nhiều phân tử nhỏ (monome) thành phân tử lớn (polime) Có liên kết đôi hoặc vòng kém bền + Trùng hợp: P.E, P.V.C, cao su buna, tơ nitron... + Đồng trùng hợp: cao su buna-S, cao su buna-N Trùng ngưng Qúa trình liên kết nhiều phân tử nhỏ thành phân tử lớn và giải phóng H2O, HCl,... Có ít nhất 2 nhóm chức có khả năng tham gia phản ứng + Trùng ngưng: nilon -6 ; nilon-7 ;... + Đồng trùng ngưng: nilon-6,6, tơ lapsan, II.Vật liệu polime: VL polime Khái niệm Các ví dụ Chất dẻo Vật liệu polime có tính dẻo - PE: nCH2=CH2     (-CH2-CH2-)n 28n - PVC: 62,5n - Thuỷ tinh hữu cơ: poli(metyl metacrylat) - PPF: phenol + anđehit fomic (mtr axit) - PP (poli propilen) : CH2=CH-CH3 à -(CH2-CH(CH3))n- - PS (poli stiren) : C6H5CH=CH2 à -(CH2-CH(C6H5))n- Tơ Vật liệu polime có dạng hình sơi dài và mảnh có độ bề nhất định * Tơ thiên nhiên: Bông, len (lông cừu), tơ tằm, * Tơ hoá học - Tơ tổng hợp: tơ poli amit (nilon, capron, tơ lapsan), .. - Tơ bán tổng hợp (tơ nhân tạo): tơ visco, tơ axetat, tơ xenlulozơ axetat. a. Tơ nilon 6,6: H2N-[CH2]6-NH2 + HOOC-[CH2]4-COOH hexametylen điamin + axit ađipic b. Tơ lapsan: HOOC-C6H4-COOH + C2H4(OH)2 axit terephtalic etilenglicol c. Tơ nitron (olon): nCH2=CH-CN (-CH2-CHCN-)n dùng để bện thành sợi len đan áo rét Cao su Là loại polime có tính đàn hồi * Cao su thiên nhiên: poli isopren (C5H8)n * Cao su tổng hợp: - Cao su buna: nCH2=CH-CH=CH2 (-CH2-CH=CH-CH2-)n - Cao su buna-S: buta-1,3-dien + Stiren (C6H5CH=CH2) - Cao su buna-N: buta-1,3-dien + acrilonitrin (vinyl xianua) CH2=CH-CN MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. Nhựa a) Nhựa PE b) Nhựa PVC c) Nhựa PS d) Nhựa PVA Thuỷ phân PVA trong môi trường kiềm: e) Nhựa PMM (thuỷ tinh hữu cơ - plexiglas) f) Nhựa PPF Poli(phenol - fomanđehit) (PPF) có 3 dạng: nhựa novolac, nhựa rezol, nhựa rezit. - Nhựa novolac: Nếu dư phenol và xúc tác axit. - Nhựa rezol: Nếu dư fomanđehit và xúc tác bazơ. - Nhựa rezit (nhựa bakelít): Nhựa rezol nóng chảy (150oC) và để nguội thu được nhựa có cấu trúc mạng lưới không gian. 2. Cao su a) Cao su buna nCH2=CH-CH=CH2 buta-1,3-đien (butađien) polibutađien (cao su buna) b) Cao su isopren c) Cao su buna – S d) Cao su buna – N e) Cao su clopren f) Cao su flopren 3. Tơ a) Tơ capron (nilon – 6) b) Tơ enang (nilon – 7) c) Tơ nilon – 6,6) d) Tơ clorin e) Tơ dacron (lapsan) CHƯƠNG V. ĐẠI CƯƠNG VỀ KIM LOẠI MỘT SỐ PHẢN ỨNG THƯỜNG GẶP 1. 2Fe + 3Cl2 2FeCl3 2. Fe + S FeS 3. 3Fe + 2O2 Fe3O4 4. Fe + 2HCl FeCl2 + H2 5. Fe + 4HNO3 Fe(NO3)3 + NO + 2H2O 6. Fe + H2O FeO + H2 7. Na + H2O NaOH + H2 8. Ba + 2H2O Ba(OH)2 + H2 9. Fe + CuSO4 FeSO4 + Cu 10. 2FeCl3 + Fe 3FeCl2 11. Fe2(SO4)3 + Cu CuSO4 + 2FeSO4 12. Fe + 2AgNO3 Fe(NO3)2 + 2Ag 13. Fe + 3AgNO3, dư Fe(NO3)3 + 3Ag 14. H2 + PbO H2O + Pb 15. Fe2O3 + 3CO 2Fe + 3CO2 16. 3Fe3O4 + 8Al 4Al2O3 + 9Fe 17. Al2O3 2Al + O2 18. 2NaCl 2 Na + Cl2 19. 2NaOH 2Na + O2 + H2O 20. MgCl2 Mg + Cl2 23. CuCl2 Cu + Cl2 24. CuSO4 + H2O Cu + O2 + H2SO4 25. 2AgNO3 + H2O 2Ag + O2 + 2HNO3 26. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 CHƯƠNG VI. KIM LOẠI KIỀM, KIM LOẠI KIỀM THỔ VÀ NHÔM MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP 1. 2Na + O2 Na2O 2. Mg + O2 MgO 3. 2Al + O2 Al2O3 4. K + Cl2 KCl 5. Ca + Cl2 CaCl2 6. Al + Cl2 AlCl3 7. Na + HCl → NaCl + H2 8. Mg + 2HCl → MgCl2 + H2 9. Al + 3HCl → AlCl3 + H2 10. 4Mg + 10HNO3 loãng → 4Mg(NO3)2 + NH4NO3 + 3H2O 11. Al + 4HNO3 đặc Al(NO3)3 + NO + 2H2O 12. 4Mg + 5H2SO4 đặc → 4MgSO4 + H2S + 4H2O 13. 2Al + 6H2SO4 đặc Al2(SO4)3 + 3SO2 + 6H2O 14. 2K + 2H2O → 2KOH + H2 15. Ca + 2H2O → Ca(OH)2 + H2 16. 2Al + 6H2O → 2Al(OH)3 + 3H2 17. 2Na + 2H2O + CuSO4 → Cu(OH)2 + Na2SO4 + H2 18. Mg + CuSO4 → MgSO4 + Cu 19. 2Al + Fe2O3 Al2O3 + 2Fe 20. 2Al + 2NaOH + 6H2O → 2Na[Al(OH)4] + 3H2 21. 2NaCl 2Na + Cl2 22. 2NaOH 2Na + O2 + H2O 23. MgCl2 Mg + Cl2 24. 2Al2O3 4Al + 3O2 25. 2NaCl + 2H2O 2NaOH + H2 + Cl2 26. NaOH + CO2 → NaHCO3 27. Ca(OH)2 + 2CO2 → Ca(HCO3)2 28. 2NaOH + CO2 → Na2CO3 + H2O 29. Ca(OH)2 + CO2 → CaCO3 + H2O 30. NaOH + HCl → NaCl + H2O 31. 2NaOH + CuSO4 → Na2SO4 + Cu(OH)2¯ 32. Ca(OH)2 + Na2CO3 → 2NaOH + CaCO3 33. 2NaHCO3 Na2CO3 + CO2­ + H2O 34. Ca(HCO3)2 CaCO3 + CO2­ + H2O 35. Mg(HCO3)2 MgCO3 + CO2­ + H2O 36. NaHCO3 + HCl → NaCl + CO2­ + H2O 37. NaHCO3 + NaOH → Na2CO3 + H2O 38. Na2CO3 + 2HCl → 2NaCl + H2O + CO2­ 39. CaCO3 + 2HCl → CaCl2 + H2O + CO2­ 40. CaCO3 + H2O + CO2 Ca(HCO3)2 41. CaCO3 CaO + CO2 42. 2KNO3 2KNO2 + O2 43. 2KNO3 + 3C + S N2 + 3CO2 + K2S 44. Ca(NO3)2 Ca(NO2)2 + O2 45. 2Mg(NO3)2 2MgO + 4NO2 + O2 46. Ca(HCO3)2 + Ca(OH)2 → 2CaCO3 + 2H2O 47. Ca(HCO3)2 + Na2CO3 → CaCO3 + 2NaHCO3 48. Mg(OH)2 + 2NH4Cl → MgCl2 + 2NH3 + 2H2O 49. Mg2+ + HPO42- + NH3 → MgNH4PO4 ↓ (màu trắng) 50. Al2O3 + 6HCl → 2AlCl3 + 3H2O 51. Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4] 52. Al(OH)3 + 3HCl → AlCl3 + 3H2O 53. Al(OH)3 + NaOH → Na[Al(OH)4] 54. AlCl3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4Cl 55. 2Al(OH)3 Al2O3 + 3H2O CHƯƠNG VII. CROM - SẮT - ĐỒNG VÀ HỢP CHẤT A – MỘT SỐ VẤN ĐỀ LÍ THUYẾT CẦN NẮM VỮNG 1. Crom - Sắt - Đồng - Cấu hình electron nguyên tử Cr : [Ar]3d54s1; Fe : [Ar]3d64s2, Cu : [Ar]3d104s1. - Thế điện cực chuẩn = -0,74V; = -0,44V; = 0,77V, = 0,34V. 2. Sơ đồ minh hoạ tính chất hoá học của crom + O2, t0 Cr2O3 (r) + NH3 CrO3 + bột Al Nước + Cl2, t0 CrCl3 (r) H2CrO4 H2Cr2O7 Cr HCl Cr+2(dd) + Cl2 Cr+3 (dd) +Br2 Cr+6 (dd) H2SO4(l) +Zn +SO2, KI Kiềm Axit Axit Cr(OH)2 +(O2+H2O) Cr(OH)3 Kiềm [Cr(OH)4]- Số oxi hoá +2 Số oxi hoá +3 Số oxi hoá +6 - Tính khử. - Tính khử và tính oxi hoá. - Tính oxi hoá. - Oxit và hiđroxit có tính bazơ. - Oxit và hiđroxit có tính lưỡng tính. - Oxit và hiđroxit có tính axit. 3. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất Số oxi hoá +2 Số oxi hoá +3 - Tính khử. - Tính oxi hoá. - Oxit và hiđroxit có tính bazơ. - Oxit và hiđroxit có tính bazơ. 4. Sơ đồ minh hoạ tính chất hoá học đồng Cu Không khí, t0 [Cu(NH3)4]2+ H+ OH- NH3 HCl + O2, HNO3, H2SO4 đ CuCl2 (r) Cu(OH)2 Cu2+ (dd) CuO (đen) dd FeCl3, AgNO3 CuSO4.5H2O Cu(NO3)2.3H2O H+ Kết tinh Không khí, 10000C Cu2O (đỏ) t0 CuCO3.Cu(OH)2 (r) Chất khử CO, NH3, t0 Không khi ẩm Khí Clo khô Số oxi hoá +2 - Tính oxi hoá. - Oxit và hiđroxit có tính bazơ. 5. Sơ lược về các kim loại Ag, Au, Ni, Zn, Sn, Pb Ag Au Ni Zn Sn Pb Số oxi hoá +1, (+2) +1, +3 +2, (+3) +2 +2, +4 +2, +4 Eo(V) Ag+/Ag +0,08 Au3+/Au +1,5 Ni2+/Ni -0,26 Zn2+/Zn -0,76 Sn2+/Sn -0,14 Pb2+/Pb -0,13 Tính khử Rất yếu Rất yếu T.Bình Mạnh Yếu Yếu B - MỘT SỐ PHẢN ỨNG HOÁ HỌC THƯỜNG GẶP (Lưu ý: Các dòng in nghiêng là phần nâng cao) 1. Fe + S FeS. 2. 3Fe + 2O2 Fe3O4. 3. 2Fe + 3Cl2 2FeCl3. 4. Fe + 2HCl FeCl2 + H2. 5. Fe + H2SO4 loãng FeSO4 + H2. 6. 2Fe + 6H2SO4 đặc Fe2(SO4)3 + 3SO2 + 6H2O. 7. Fe + 4HNO3 loãng Fe(NO3)3 + NO + 2H2O. 8. Fe + 6HNO3 đặc Fe(NO3)3 + 3NO2 + 3H2O. 9. Fe (dư) + HNO3 Fe(NO3)2 + ..... 10. Fe (dư) + H2SO4 (đặc) FeSO4 + ..... 11. Fe + CuSO4 FeSO4 + Cu. 12. Fe + 2AgNO3 Fe(NO3)2 + 2Ag. 13. Fe + 3AgNO3 (dư) Fe(NO3)3 + .... 14. 3Fe + 4H2O Fe3O4 + 4H2. 15. Fe + H2O FeO + H2. 16. 3FeO + 10HNO3 đặc 3Fe(NO3)3 + NO + 5H2O. 17. 2FeO + 4H2SO4 đặc Fe2(SO4)3 + SO2 + 4H2O. 18. FeO + H2SO4 loãng FeSO4 + H2O. 19. FeO + 2HCl FeCl2 + H2O. 20. FeO + CO Fe + CO2. 21. Fe(OH)2 + 2HCl FeCl2 + 2H2O. 22. Fe(OH)2 + H2SO4 FeSO4 + 2H2O. 23. 4Fe(OH)2 + O2 + 2H2O 4Fe(OH)3. 24. FeCl2 + 2NaOH Fe(OH)2 + 2NaCl. 25. 2FeCl2 + Cl2 2FeCl3. 26. 10FeSO4 + 2KMnO4 + 8H2SO4 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O. 27. 3Fe2O3 + CO 2Fe3O4 + CO2. 28. Fe2O3 + CO 2FeO + CO2. 29. Fe2O3 + 3CO 2Fe + 3CO2. 30. Fe2O3 + 3H2SO4 loãng Fe2(SO4)3 + 3H2O. 31. Fe2O3 + 6HCl 2FeCl3 + 3H2O. 32. Fe2O3 + 3H2SO4 Fe2(SO4)3 + 3H2O. 33. FeCl3 + 3NaOH Fe(OH)3 + 3NaCl. 34. 2FeCl3 + Fe 3FeCl2. 35. 2FeCl3 + Cu 2FeCl2 + CuCl2. 36. 2FeCl3 + 2KI 2FeCl2 + 2KCl + I2. 37. 2Fe(OH)3 Fe2O3 + 3H2O. 38. 2Fe(OH)3 + 3H2SO4 Fe2(SO4)3 + 6H2O. 39. Fe(OH)3 + 3HCl FeCl3 + 3H2O. 40. 2FeS2 + 14H2SO4 Fe2(SO4)3 + 15SO2 + 14H2O. 41. 4FeS2 + 11O2 2Fe2O3 + 8SO2. 42. 4Cr + 3O2 2Cr2O3. 43. 2Cr + 3Cl2 2CrCl3. 44. 2Cr + 3S Cr2S3. 45. Cr + 2HCl CrCl2 + H2. 46. Cr + H2SO4 CrSO4 + H2. 47. 2Cr + 3SnCl2 2CrCl3 + 3Sn. 48. 4Cr(OH)2 + O2 + 2H2O 4Cr(OH)3. 49. Cr(OH)2 + 2HCl CrCl2 + 2H2O. 50. Cr(OH)3 + NaOH Na[Cr(OH)4] (hay NaCrO2). 51. Cr(OH)3 + 3HCl CrCl3 + 3H2O. 52. 2Cr(OH)3 Cr2O3 + 3H2O. 53. 2CrO + O2 2Cr2O3. 54. CrO + 2HCl CrCl2 + H2O. 55. Cr2O3 + 3H2SO4 Cr2(SO4)3 + 3H2O. 56. 2Cr2O3 + 8NaOH + 3O2 4Na2CrO4 + 4H2O. 57. Cr2O3 + 2Al 2Cr + Al2O3. 58. CrO3 + H2O H2CrO4. 59. 2CrO3 + H2O H2Cr2O7. 60. 4CrO3 2Cr2O3 + 3O2. 61. 2CrO3 + 2NH3 Cr2O3 + N2 + 3H2O. 62. 4CrCl2 + O2 + 4HCl 4CrCl3 + 2H2O. 63. CrCl2 + 2NaOH Cr(OH)2 + 2NaCl. 64. 2CrCl2 + Cl2 2CrCl3. 65. 2CrCl3 + Zn ZnCl2 + 2CrCl2. 66. CrCl3 + 3NaOH Cr(OH)3 + 3NaCl. 67. 2CrCl3 + 3Cl2 + 16NaOH 2Na2CrO4 + 12NaCl + 8H2O. 68. 2NaCrO2 + 3Br2 + 8NaOH 2Na2CrO4 + 6NaBr +4H2O 69. 2Na2Cr2O7 + 3C 2Na2CO3 + CO2 + 2Cr2O3. 70. Na2Cr2O7 + S Na2SO4 + Cr2O3. 71. Na2Cr2O7 + 14HCl 2CrCl3 + 2NaCl +3Cl2+ 7H2O. 72. K2Cr2O7 + 3H2S + 4H2SO4 Cr2(SO4)3 +3S + K2SO4 + 7H2O. 73. K2Cr2O7 + 3K2SO3 + 4H2SO4 Cr2(SO4)3 + 4K2SO4 + 4H2O. 74. K2Cr2O7+6KI+7H2SO4 Cr2(SO4)3+4K2SO4+3I2+7H2O. 75. K2Cr2O7 + 6FeSO4 + 7H2SO4 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O. 76. (NH4)2Cr2O7 Cr2O3 + N2 + 4H2O. 77. 2Na2Cr2O7 2Na2O + 2Cr2O3 + 3O2. 78. 2Na2CrO4 + H2SO4 Na2Cr2O7 + Na2SO4 + H2O. 79. Cu + Cl2 CuCl2. 80. 2Cu + O2 2CuO. 81. Cu + S CuS. 82. Cu + 2H2SO4 đặc CuSO4 + SO2 + 2H2O. 83. Cu + 4HNO3 đặc Cu(NO3)2 + 2NO2 + 2H2O. 84. 3Cu + 8HNO3 loãng 3Cu(NO3)2 + 2NO + 4H2O. 85. Cu + 2AgNO3 Cu(NO3)2 + 2Ag. 86. Cu + 2FeCl3 CuCl2 + 2FeCl2. 87. 3Cu + 8NaNO3 + 4H2SO4 3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O. 88. 2Cu + 4HCl + O2 2CuCl2 + 2H2O. 89. CuO + H2SO4 CuSO4 + H2O. 90. CuO + 2HCl CuCl2 + H2O. 91. CuO + H2 Cu + H2O. 92. CuO + CO Cu + CO2. 93. 3CuO + 2NH3 N2 + 3Cu + 3H2O. 94. CuO + Cu Cu2O. 95. Cu2O + H2SO4 loãng CuSO4 + Cu + H2O. 96. Cu(OH)2 + 2HCl CuCl2 + 2H2O. 97. Cu(OH)2 + H2SO4 CuSO4 + 2H2O. 98. Cu(OH)2 CuO + H2O. 99. Cu(OH)2 + 4NH3 [Cu(NH3)4]2+ + 2OH-. 100. 2Cu(NO3)2 2CuO + 2NO2 + 3O2. 101. CuCl2 Cu + Cl2. 102. 2Cu(NO3)2 + 2H2O 2Cu + 4HNO3 + O2. 103. 2CuSO4 + 2H2O 2Cu + 2H2SO4 + O2. 104. CuCO3.Cu(OH)2 2CuO + CO2 + H2O. 105. CuS + 2AgNO3 2AgS + Cu(NO3)2. 106. CuS + 4H2SO4 đặc CuSO4 + 4SO2 + 4H2O. 107. 2Ni + O2 2NiO. 108. Ni + Cl2 NiCl2. 109. Zn + O2 2ZnO. 110. Zn + S ZnS. 111. Zn + Cl2 ZnCl2. 112. 2Pb + O2 2PbO. 113. Pb + S PbS. 114. 3Pb + 8HNO3 loãng 3Pb(NO3)2 + 2NO + 4H2O. 115. Sn + 2HCl SnCl2 + H2. 116. Sn + O2 SnO2. 117. 118. Ag + 2HNO3(đặc) AgNO3 + NO2 + H2O. 119. 2Ag + 2H2S + O2 2Ag2S + 2H2O. 120. 2Ag + O3 Ag2O + O2. 121. Ag2O + H2O2 2Ag + H2O + O2. 122. 2AgNO3 2Ag + 2NO2 + O2. 123. 4AgNO3 + 2H2O 4Ag + 4HNO3 + O2. 124. Au +HNO3 + 3HCl AuCl3 + 2H2O + NO. MỘT SỐ KIẾN THỨC CƠ BẢN PHẦN KIM LOẠI CHUYÊN ĐỀ 1: KIM LOẠI, CẤU HÌNH ELECTRON I. VỊ TRÍ CỦA KIM LOẠI - Nhóm IA (trừH), IIA, IIIA(trừ B), một phần nhóm IVA, VA,VIA - Các nhóm B (IB→VIIIB) - Họ lantan và actini (2 hàng cuối BTH) II. TÍNH CHẤT KIM LOẠI: 1. Tính chất vật lí chung: dẻo, dẫn điện, dẫn nhiệt, ánh kim. Nguyên nhân : là do các electron tự do gây ra 2. Tính chất vật lí riêng : khối lương riêng, nhiệt độ nóng chảy, tính cứng. Nguyên nhân: do độ bền liên kết KL, ntử khối, kiểu mạng tinh thể ( không do các e tự do) - Kim loại dẻo nhất: Au (vàng) + KLR lớn nhất (nặng nhất): Os (osimi) + KLR nhỏ nhất (nhẹ nhất) : Li (liti) - Kim loại dẫn điện, dẫn nhiệt tốt nhất: Ag, Cu, Au, Al, Fe + tonc thấp nhất: Hg (thuỷ ngân) + tonc cao nhất: W (vonfam) - Ánh kim: hầu hết kim loại + mềm nhất: Cs (xesi) + cứng nhất: Cr (crom) 3. Cấu tạo mạng tinh thể Kiểu mạng tinh thể Kim loại Lập phương tâm khối KLK (Li, Na, K, Rb, Cs), Ba, Cr, Feα Lập phương tâm diện Ca, Sr, Al , Feγ , Cu Lục phương Be, Mg, Cr 4. Tính chất hoá học chung: Có tính khử (dễ bị oxi hoá) dễ nhường electron trở thành ion dương : M → Mn+ + ne (do bán kính nguyên tử lớn, độ âm điện nhỏ, điện tích hạt nhân nhỏ, năng lượng ion hoá nhỏ) Công thức KLK (IA) KLK thổ (IIA) IIIA Oxit R2O RO R2O3 CaO: vôi sống Hidroxit ROH R(OH)2 R(OH)3 Ca(OH)2: nước vôi trong, vôi sữa, vôi tôi Muối cacbonat R2CO3 RCO3 Muối halogenua RCl RCl2 RCl3 CaCO3: đá vôi 4. Ứng dụng: Kim loại / hợp chất Ứng dụng Xesi (Cs) Làm tế bào quang điện Na, K Làm chất trao đổi nhiệt trong lò phản ứng hạt nhân Tecmit (Al + Fe2O3) Dùng hàn đường ray xe lửa Phèn chua Làm trong nước CuSO4 khan Dùng phát hiện dấu vết của nước trong các chất lỏng Pb Ngăn cản tia phóng xạ NaHCO3 Thuốc đau dạ dày, nước giải khát III. CẤU HÌNH ELECTRON: * Cấu hình electron nguyên tử: Nhóm IA (KLK): ns1 Nhóm IIA(KLK thổ) ns2 Nhóm IIIA ns2 np1 Một số KL khác Li (Z=3): 1s22s1 Be (Z=4): 1s22s2 B (Z=5): 1s22s22p1 Cr (Z=24): [Ar] 3d54s1 Na (Z=11):1s22s22p63s1 Mg (Z=12):1s22s22p63s2 Al (Z= 13):1s22s22p63s23p1 Fe (Z=26): [Ar] 3d64s2 K (Z=19): [Ar] 4s1 Ca (Z=20): [Ar] 4s2 Cu ( Z=29): [Ar] 3d104s1 *Cấu hình ion: He (ns2) Ne (1s22s22p6) Ar (1s22s22p63s23p6) Một số ion KL khác Li+ (Z=3) ; Be2+ (Z=4) B3+ (Z=5) Na+ (Z=11) ; Mg2+(Z=12) Al3+ (Z= 13) K+ (Z=19) Ca2+ (Z=20) Cr2+ (Z=24): [Ar] 3d4 Cr3+ (Z=24): [Ar] 3d3 O2- (Z=8) F- (Z=9) S2- (Z=16) Cl- (Z=17) Fe2+ (Z=26): [Ar] 3d6 Fe3+ (Z=26): [Ar] 3d5 Cu+ ( Z=29): [Ar] 3d10 Cu2+ ( Z=29): [Ar] 3d9 ------------------------------------------------------------------------------------------------------------------------------------- CHUYÊN ĐỀ 2: DÃY ĐIỆN HOÁ – DÃY KIM LOẠI I. Dãy điện hoá kim loại: Tính khử của kim loại giảm, tính oxi hóa của ion kim loại tăng Không td với HNO3 và H2SO4 đặc nóng Li+ K+ Ba2+ Ca2+ Na+ Mg2+ Al3+ Zn2+ Cr3+ Fe2+ Ni2+ Sn2+ Pb2+ 2H+ Cu2+ Fe3+ Hg Ag+ Pt2+ Au3+ Li K Ba Ca Na Mg Al Zn Cr Fe Ni Sn Pb H2 Cu Fe2+ Hg Ag Pt Au Tác dụng với H2O→ H2 Tác dụng với axit (HCl, H2SO4 loãng) → muối + H2 1. Nhận xét : (1) Tính khử kim loại từ trái sang phải giảm : Mg > Al > Fe. (2) Tính oxy hoá ion kim loại trái sang phải tăng : Mg2+ < Al3+ < Fe2+ (3) Kim loại có tính khử mạnh sẽ p/ứ với ion kim loại có tính oxi hoá mạnh theo quy tắc anpha 2. Lưu ý : Fe + 2FeCl3 " 3FeCl2 Cu + 2FeCl3 " 2FeCl2 + CuCl2 Fe + Fe2(SO4)3 " 3FeSO4 Cu + Fe2(SO4)3 " 2FeSO4 + CuSO4 Fe + 2Fe (NO3)3 " 3 Fe(NO3)2 Cu + 2Fe (NO3)3"2Fe(NO3)2+Cu(NO3)2. Fe + FeCl2 " phản ứng không xảy ra Cu + FeCl2 " p/ứng không xảy ra Fe + FeSO4 " phản ứng không xảy ra Cu + FeSO4 " p/ứng không xảy ra Fe + Fe(NO3)2 " phản ứng không xảy ra Cu + Fe(NO3)2" p/ứng không xảy ra II. Dãy hoạt động kim loại: 1. Có 5 kim loại (Li, K, Ba, Ca, Na) tác dụng H2O " bazơ + H2 K + H2O " KOH + 1/2 H2 Na + H2O " NaOH + 1/2 H2 Ca + 2H2O " Ca(OH)2 + H2 Ba + 2H2O " Ba(OH)2 + H2 2. Có 5 kim loại ( Cu, Hg, Ag, Pt, Au ) không tác dụng với dd HCl, HBr, H2SO4 loãng, H3PO4. 3. Kim loại đứng trước (không tan trong nước) đẩy kim loại đứng sau ra khỏi dd muối. III. Các chất tan và kết tủa lưu ý: III. Các chất tan và kết tủa lưu ý: 1.Kim loại, oxyt, bazơ : Tan TT Kim loại Oxyt Bazơ Ghi chú 1 2 3 4 K Na Ca Ba K2O Na2O CaO BaO KOH NaOH Ca(OH)2 Ba(OH)2 Tất cả đều tan 5 6 7 8 Li Rb Cs Sr Li2O Rb2O CS2O SrO LiOH RbOH CsOH Sr(OH)2 2. Bazơ, muối clorua, Sunfat, cacboat, photphat TT Bazơ OH- Muối clorua Cl- Sunfat SO Cacbonat CO Photphát PO 1 2 3 4 5 6 7 8 9 Mg(OH)2$Trằng Zn(OH)2$ Trắng Fe(OH)2$ T Xanh Cu(OH)2$ Xanh Cr(OH)2$ Pb(OH)2$ Trắng Al(OH)3$ Trắng Fe(OH)3$ nâu đỏ Cr(OH)3$lục xám AgCl$ PbCl2$ BaSO4$ PbSO4$ BaCO3$ PbCO3$ CaCO3$ MgCO3$ (trắng) Ba3(PO4)2$ Pb3(PO4)2$ Ca3(PO4)2$ Mg3(PO4)2$ Ag3PO4$ $ vàng a. Crom (Cr) : Trắng bạc CrO đen Cr2O3 : xanh thẫm CrCl2 CrCl3 Cr(OH)2: màu vàng Cr(OH)3 : Lục xám CrO3 : Rắn đỏ, thẫm , tan trong nước Na2CrO4 Vàng chanh Na2Cr2O7 : Cam b. Săt (Fe) xám Fe(OH)2 $ trắng xanh dễ hoá nâu FeCl2 FeSO4 xanh rất nhạt ( không màu) Fe(NO3)2 Fe(OH)3 $ : nâu đỏ FeCl3 Fe2(SO4)3 dd nâu đỏ Fe(NO3)3 c. Đồng (Cu) đỏ * Cu(OH)2 $ : Xanh CuCl2, CuSO4, Cu(NO3) : dd xanh CuSO4 : khan (trắng) 1.Kim loại, oxit, bazơ : Tan Kim loại Oxit Bazơ Ghi chú Li, Na, K, Rb, Cs Li2O, Na2O, K2O, Rb2O, Cs2O LiOH, NaOH, KOH, RbOH, CsOH Tất cả đều tan Ca, Sr, Ba CaO, SrO, BaO Ca(OH)2, Sr(OH)2, Ba(OH)2 Mg tan chậm trong nước lạnh, tan nhanh hơn trong nước nóng Be không phản ứng ở mọi điều kiện. 2. Bazơ, oxit và muối (một số khác ở phần nhận biết) a. Săt (Fe) trắng xám Fe(OH)2 $ trắng xanh, hoá nâu FeCl2 FeSO4 màu lục nhạt Fe(NO3)2 Fe(OH)3 $ : nâu đỏ FeCl3 Fe2(SO4)3 dd màu vàng nâu Fe(NO3)3 b. Crom (Cr) : Trắng bạc CrO đen Cr2O3 : xanh thẫm CrCl2 CrCl3 Cr(OH)2: màu vàng Cr(OH)3 : Lục xám CrO3 : Rắn đỏ, thẫm , tan trong nước Na2CrO4 Vàng chanh Na2Cr2O7 : da cam c. Đồng (Cu) đỏ * Cu(OH)2 $ : Xanh CuCl2, CuSO4, Cu(NO3) : dd xanh CuSO4 : khan (màu trắng) ------------------------------------------------------------------------------------------------------------------------------------- CHUYÊN ĐỀ 3: ĐIỀU CHẾ KIM LOẠI – ĂN MÒN KIM LOẠI I. ĐIỀU CHẾ KIM LOẠI: 1.Nguyên tắc: khử các ion kim loại thành nguyên tử kim loại : Mn+ + ne → M I. Sơ đồ điều chế kim loại Li K Ba Ca Na Mg Al Mn Cr Zn Fe Ni Sn Pb H2 Cu Hg Ag Pt Au -Nhiệt luyện -Thuỷ luyện -Thuỷ luyện -Điện phân n/c -Điện phân n/c -Điện phân dung dịch 1. Kim loại (K,Li,Ba,Ca,Na,Mg ) Phương pháp điện phân nóng chảy 2. Kim loại Al : Thuỷ luyện , điện phân nóng chảy Al2O3 3. Kim loại từ Mn sau: phương pháp thuỷ luyện, nhiệt luyện, điện phân dd II. Các phương pháp: 1. Phương pháp thuỷ luyện: Kim loại đứng trước đẩy kim loại đứng sau ra khỏi dd muối của chúng trừ : K, Na, Ca, Ba,Li Ví dụ: Fe + CuSO4 → FeSO4 + Cu 2. Phương pháp nhiệt luyện Khử các oxýt kim loại về kim loại dùng các chất khử C, CO, H2, Al. ( phương pháp này điều chế những kim loại sau nhôm) CuO + CO " Cu + CO2 FeO + H2 " Fe + H2O ZnO + H2 " Zn + H2O Fe2O3 + 2Al " Al2O3 + 2Fe 3. Phương pháp điện phân: a. Kim loại Al và những kim loại đứng trước Al điện phân nóng chảy MgCl2 Mg + Cl2 2Al2O3 4Al + 3O2 b. Kim loại sau nhôm + Điện phân dung dịch muối clorua ( H2O không tham gia) CuCl2 Cu + Cl2 + Điện phân dd muối sunfat, muối nitrat ( H2O tham gia ) CuSO4 + H2O Cu + 1/2O2 + H2SO4 Cu(NO3)2 + H2O Cu + 1/2O2 + 2HNO3 2. Các phương pháp: Điện phân nóng chảy Nhiệt luyện Thuỷ luyện + Điện phân dung dịch Li K Ba Ca Na Mg Al Mn Zn Cr Fe Ni Sn Pb Mn Zn Cr Fe Ni Sn Pb Cu Hg Ag Pt Au Dùng dòng điện một chiều để khử các ion kim loại. + Li, Na, K: đpnc muối halogenua (RCl) hoặc hidroxit (ROH) Dùng nhiệt độ cao chất khử mạnh (C, CO, H2, Al) khử các oxit kim loại về kim loại. VD: Fe2O3 + 2Al Al2O3 + 2Fe CuO + CO Cu + CO2 KL đứng trước đẩy KL đứng sau ra khỏi dd muối của chúng (trừ:K, Na, Ca, Ba) VD: Fe + CuSO4 → FeSO4 + Cu + Mg, Ca, Ba : đpnc muối halogenua (RCl2) +đpdd muối clorua (H2O không tham gia): CuCl2 Cu + Cl2 + Kim loại Al : đpnc Al2O3 Định luật Faraday: m = AIt / nF F = 96500 + đpdd muối sunfat, muối nitrat (H2O tham gia): CuSO4 + H2OCu +½ O2 +H2SO4 Cu(NO3)2 +H2OCu +½ O2+2HNO3 Chú ý: - Cực âm : (Catốt ) xảy ra quá trình khử - Cực dương : (Anốt ) xảy ra q/trình oh II. ĂN MÒN KIM LOẠI : Ăn mòn hóa học và Ăn mòn điện hóa học * Phân biệt : Giống : đều là pứ oxi hoá khử Khác : - Ăn mòn hóa học : không phát sinh dòng điện. - Ăn mòn điện hóa học : phát sinh dòng điện. * Điều kiện để có ăn mòn điện hóa (3 đk ) * Cơ chế ăn mòn điện hóa. Điện cực âm (anốt) : M → Mn+ + ne : quá trình oxh ( kim loại có tính khử mạnh hơn bị ăn mòn) Điện cực dương (catốt) : 2H+ +2e → H2 : quá trình khử * Cách chống ăn mòn kim loại: bảo vệ bề mặt (sơn , mạ,) và bảo vệ điện hóa (dùng kim loại có tính khử mạnh hơn bảo vệ kim loại có tính khử yếu hơn) ------------------------------------------------------------------------------------------------------------------ CHUYÊN ĐỀ 4: LƯỠNG TÍNH Hoá chất Phản ứng với Axit Phản ứng với Kiềm Lưỡng tính Al ; Zn x x Không Cr x Không Không Al2O3 ; Al(OH)3 x x x ZnO ; Zn(OH)2 x x x Cr2O3 ; Cr(OH)3 x x x HCO x x x (NH4)2CO3 , CH3COONH4 x x x Aminoaxit (NH2-CH2-COOH) x x x ------------------------------------------------------------------------------------------------------------------------------------- CHUYÊN ĐỀ 5 : AXIT I. Axit HCl, H2SO4 loãng , HBr, H3PO4 1. Kim loại (Trước H) + Axit " Muối + H2 2. Có 5 kim loại không tác dụng axit Cu, Hg, Ag, Pt, Au Fe + 2HCl " FeCl2 + H2 ; Cu + HCl " Không xảy ra ; Cu + 1/2 O2 + 2HCl " CuCl2 +H2O II. Axit HNO3 và H2SO4 đặc 1. Tác dụng tất cả kim loại trừ Au, Pt 2. HNO3 đặc nguội và H2SO4 đặc nguội không tác dụng Al, Fe, Cr 3. Các chất có tính khử đều bị oxy hoá bởi HNO3, H2SO4 đặc,nóng: FeO, Fe3O4, Fe, Kim loại, những chất có số oxi hóa chưa cao,... chất có tính khử Kim loại + " Muối + + H2O (hoá trị cao nhất) A Có thể là: N2O,N2, NH3, NH4NO3 chất có tính khử Kim loại + H2SO4 đặc Muối + SO2 + H2O (hoá trị cao nhất) (S hoặc H2S) Bài tập: Cân bằng, cho biết tổng số hệ số 1. Fe + HNO3 " Fe(NO3)3 + NO2 + H2O 2. Cu + HNO3 " Cu(NO3)2 + NO2 + H2O 3. Fe + HNO3 " Ca(NO3)2 + NO + H2O 4. Cu + HNO3 " Cu(NO3)2 + NO + H2O 5. Al + HNO3 " Al(NO3)3 + NO2 + H2O 6. Al + HNO3 " Al(NO3)3 + NO + H2O 7. Al + H2SO4 " Al2(SO4)3 + SO2 + H2O 8. Cu + H2SO4 " CuSO4 + SO2 + H2O. ------------------------------------------------------------------------------------------------------------------------------------- CHUYÊN ĐỀ 6 : HIỆN TƯỢNG HOÁ HỌC I Lý thuyết 1. Có 4 kim loại ( K, Na, Ca, Ba) tác dụng trong nước cho bazơ + H2 Chất rắn từ từ tan ra, có khí bay ra. Vd: Na + H2O " NaOH + ½ H2 2. Có 4 oxit bazơ ( K 2O, Na2O, CaO, BaO) tác dụng H2O tạo bazơ Chất rắn từ từ tan ra. Vd: Na2O + H2O" 2 NaOH 3. Có 4 bazơ tan trong nước ( KOH, NaOH, Ca(OH)2, Ba(OH)2) Chất rắn tan từ từ trong nước 4. Al Tác dụng dung dịch KOH, NaOH, Ca(OH)2, Ba(OH)2) Nhôm từ từ tan ra và sủi bọt : Al + NaOH + H2O " NaAlO2 + 3/2H2 5. Al2O3 , Al(OH)3 tác dụng dd KOH, NaOH, Ca(OH)2, Ba(OH)2. Al2O3 + 2NaOH " NaAlO2 + H2O ; Al(OH)3 + NaOH " NaAlO2 +H2O Chất rắn từ từ tan ra 6. Kim loại (trước H2 ) + HCl, H2SO4 tạo muối và sủi bọt khí H2 * Chất rắn từ từ tan và sủi bọt. Vd: Fe + 2HCl " FeCl2 + H2 7. Oxit và hidroxit tác dụng HCl, H2SO4 loãng: Chất rắn từ từ tan ra CHUYÊN ĐỀ 7, 8 : TÍNH KHỬ- OXI HOÁ- NHIỆT PHÂN MUỐI VÀ MỘT SỐ VẤN ĐỀ KHÁC I. Tính khử, tính oxi hoá 1. Chất khử (chất bị oxi hoá) : Số oxi hoá tăng 2. Chất oxi hoá (chất bị khử) : Số oxi hoá giảm 3. Tính oxi hoá - khử các chất thường gặp: Tính khử Tính khử - tính oxi hoá Tính oxi hoá Kim loại Fe FeO, Fe(OH)2, FeCl2, FeSO4, Fe3O4 Fe2O3 ; FeCl3 ; Fe2(SO4)3 hay Fe(III) Cr NaCrO2, CrCl3 hay Cr(III) CrO3 ; Na2CrO4 ; Na2Cr2O7 hay Cr(VI) II. Phản ứng nhiệt phân: Muối cacbonat : CO32- + Muối cacbonat của kim loại kiềm ( nhóm IA) không bị nhiệt phân + Chỉ có muối cacbonat kim loại kiềm thổ (kim loại IIA): bị nhiệt phân tạo oxit và CO2 MgCO3 MgO + CO2 K2CO3 không xảy ra phản ứng CaCO3 CaO + CO2 Na2CO3 không xảy ra phản ứng BaCO3 BaO + CO2 Muối Hidrocacbonat : HCO3- Muối hidrocacbonat của kim loại kiềm và kim loại kiềm thổ đều bị nhiệt phân VD: 2NaHCO3 Na2CO3 + CO2 + H2O ; 2KHCO3 K2CO3 + CO2 + H2O Ba(HCO3)2 BaCO3 + CO2 + H2O à BaCO3BaO +CO2+ H2O (nhiệt phân đến cùng) Ca(HCO3)2 CaCO3 + CO2 + H2O à CaCO3 CaO + CO2 + H2O (tương tự) Mg(HCO3)2 MgCO3 + CO2 + H2O à MgCO3 MgO + CO2 + H2O (tt) Muối Nitrat : NO3- Các muối nitrat của kim lọai họat động mạnh (trước Mg) muối nitrit + O2 Các muối nitrat của kim lọai họat động trung bình (Mg¦ Cu) oxit kim lọai + NO2 + O2 Muối nitrat của kim lọai họat động yếu (sau Cu) kim lọai + NO2 + O2 VD: KNO3 KNO2 + ½ O2 Ca(NO3)2 Ca(NO2)2 + O2 Canxi nitrit 4Al(NO3)3 2Al2O3 +12NO2 +3O2 2AgNO3 2 Ag + 2NO2 +O2 4. Hidroxit (Bazơ) * Bazơ tan không bị nhiệt phân : KOH, NaOH, Ca(OH)2, Ba(OH)2 * Bazơ không tan bị nhiệt phân tạo oxit + H2O Mg(OH)2 MgO + H2O ; 2Fe(OH)3 Fe2O3 + 3H2O Chú ý: Nếu nhiệt phân Fe(OH)2 ngoài không khí: (tương tự với Cr(OH)2 ) 4Fe(OH)2 trắng xanh + O2 + 2H2O " 4Fe(OH)3 nâu đỏ . Sau đó: 2Fe(OH)3 Fe2O3 + 3H2O Hay viết gọn: 2Fe(OH)2 + ½ O2 Fe2O3 + 2H2O III. Nước cứng: nước chứa nhiều ion Ca2+ và Mg2+ Phân loại Chứa gốc Chất làm mềm nước cứng Tạm thời HCO Đun nóng, Ca(OH)2 vừa đủ, Na2CO3 hoặc K2CO3 ; Na3PO4 hoặc K3PO4 Vĩnh cửu Cl- , SO Na2CO3 hoặc K2CO3 ; Na3PO4 hoặc K3PO4 Toàn phần Cả : HCO; Cl- ; SO Na2CO3 hoặc K2CO3 ; Na3PO4 hoặc K3PO4 IV. Thạch cao (canxi sunfat): CaSO4 + Thạch cao sống: CaSO4.2H2O (dùng sản xuất xi măng) + Thạch cao nung: CaSO4. H2O hoặc 2CaSO4.H2O (dùng để đúc tượng và bó bột khi gãy xương) + Thạch cao khan: CaSO4 V. Một số Quặng: Quặng sắt: Quặng nhôm: Khoáng vật của Ca, Mg + Manhetit: Fe3O4(chứa nhiều sắt nhất,hiếm nhất) + Hêmantit đỏ: Fe2O3 + Hêmantit nâu: Fe2O3.nH2O + Xedirit: FeCO3 + Pirit: FeS2 (Boxit : Al2O3.2H2O ) Canxit (CaCO3) Magiezit ( MgCO3) Đolomit (CaCO3.MgCO3) VI. Hợp kim: + Vàng tây: Au-Ag-Cu + Sắt tây: Fe-Sn + Đồng bạch: Cu-Ni + Vàng 9 cara: Au-Cu + Tôn: Fe-Zn + Đồng thanh: Cu-Sn + electron: hợp kim của Al + Gang, thép : Fe - C + Đồng thau: Cu-Zn VII. Bài toán CO2 tác dụng với NaOH: . Nếu: (chú ý: nếu 1<∆<2 ta có hpt VIII. Một số vấn đề cần lưu ý: + Phèn chua: K2SO4.Al2(SO4)3.24H2O. Khi thay K+ bằng Li+, NH4+, Na+ ta được phèn nhôm + Sự chuyển màu của muối cromat: C2O72- + OH- ↔ CrO42- + H+ đicromat (màu da cam) cromat (màu vàng) + Kim loại không tác dụng với nước ở nhiệt độ thường: Be + Trong nhóm kim loại kiềm, kim loại có nhiệt độ nóng chảy thấp nhất: Cs + Hiện tượng xâm thực và thạch nhũ : CaCO3 + CO2 + H2O ↔ Ca(HCO3)2 MỘT SỐ LOẠI QUẶNG I. Quặng sắt: Hematit đỏ: Fe2O3 khan Hematit nâu (limonit): Fe2O3.nH2O Manhetit: Fe3O4 Xiderit: FeCO3 Pirit: FeS2 (không dùng qặng này để điều chế Fe vì chứa nhiều lưu huỳnh, dùng để điều chế H2SO4). Xementit : Fe3C. Pirolosit : MnO2. Inmenit : FeTiO3. II. Quặng kali, natri: Muối ăn : NaCl ; Sivinit: KCl.NaCl Cacnalit: KCl.MgCl2.6H2O Xô đa : Na2CO3 Diêm tiêu: NaNO3 Cacnalit: KCl.MgCl2.6H2O (Dựa vào độ tan khác nhau của các muối clorua đối với nhiệt độ để tách riêng KCl). III. Quặng canxi, magie: Đá vôi, đá phấn. CaCO3 Thạch cao : CaSO4.2H2O Photphorit :Ca3(PO4)2 Apatit: Ca5F(PO4)3 hay 3Ca3(PO4)2.CaF2 Đolomit CaCO3.MgCO3 (đá bạch vân). Florit: CaF2. Cacnalit: KCl.MgCl2.6H2O Manhezit : MgCO3 , Cainit: KCl.MgCl2.6H2O VI. Quặng nhôm: Boxit: Al2O3.nH2O (thường lẫn SiO2, Fe2O3 và một số tạp chất khác). Cryolit: Na3AlF6 hay AlF3.3NaF Cao lanh: Al2O3.2SiO2.2H2O Mica: K2O.Al2O3.6SiO2.2H2O Berin :Al2O3.3BeO.6SiO2 Anotit : CaO.Al2O3.2SiO2. Đất sét : Al2O3.SiO2.2.H2O. phèn chua K2SO4 ·Al2(SO4)3 · 24H2O phèn amoni Al2(SO4)3(NH4)2SO4.24H2O V. Quặng đồng Chancozit : Cu2S Cancoporit : CuS.FeS ( CuFeS2) Malakit : CuCO3.Cu(OH)2 Azurite : 2CuCO3.Cu(OH)2 5. Cuprit : Cu2O MÀU CỦA MỘT SỐ HỢP CHẤT Cr(OH)2 vàng Cr(OH)3 xanh xám CrO đen Cr2O3 xanh thẵm CrO3 đỏ thẵm Fe3O4: xanh đen. Fe2O3: đỏ FeO : đen. FeSO4.7H2O: xanh lục.  Fe(OH)3: đỏ nâu. FeCl2: dung dịch lục nhạt FeCl3: vàng nâu. MnCl2 : dung dịch: xanh lục; tinh thể: đỏ nhạt. KMnO4: tinh thể màu đỏ tím. K2MnO4: xanh lục. MnO2 : kết tủa màu đen. K2CrO4: vàng cam. K2Cr2O7: đỏ da cam. ZnCl2 : bột trắng CrCl2 : lục sẫm. Al2O3: trắng Au2O3: nâu đen. AgCl: trắng.( Hóa Đen Ngoài Ánh Sáng). Al2(SO4)3: màu trắng. AgI : vàng đậm. AlCl3 ( tinh thể lục phương) màu trắng, thường ngả màu vàng nhạt vì chứa FeCl3. AgBr : Vàng Nhạt NaCl: không màu, nhưng muối ăn có màu trắng là do có lẫn MgCl2 và CaCl2. CuS ,FeS ,Fe2S3 ,Ag2S ,PbS ,HgS: Đen. MnS,SbS: Hồng. SnS: Nâu. ZnS:Trắng. CdS : Vàng. ZnS : trắng. PbI2 : vàng tươi, tan nhiều trong nước nóng. Hg2I2 ; vàng lục. Ag2CrO4: đỏ gạch. BaCrO4 : vàng. PbCrO4 : vàng. Hg2CrO4 : đỏ. BaSO4, SrSO4, CaSO4, PbSO4 : trắng CaC2O4 : trắng. As2S3, As2S5 : vàng. Fe(SCN)3 dd màu đỏ máu. In(OH)3: kết tủa nhày, màu trắng. Tl(OH)3, TlOOH: kết tủa nhày, màu hung đỏ Fe(OH)2 : kết tủa trắng xanh hay lục nhạt. Mn(OH)2: nâu Cu(OH)2: Keo Xanh. Al(OH)3 : Keo Trắng. CuCl2 : tinh thể màu nâu, dd xanh lá cây. CuSO4: dd xanh lam. Cu2O: đỏ gạch. GaI3 và InI3: màu vàng. TlI3: màu đen. Tl2O: bột màu đen. TlOH: tinh thể màu vàng. Zn3P2: tinh thể nâu xám H2SiO3: kết tủa keo . SrSO4 trắng, HgI2 đỏ,... Li-màu trắng bạc . Na-màu trắng bạc. Mg-màu trắng bạc. K-có màu trắng bạc khi bề mặt sạch. Ca-màu xám bạc. B-Có hai dạng thù hình của bo; bo vô định hình là chất bột màu nâu, nhưng bo kim loại thì có màu đen. N-là một chất khí ở dạng phân tử không màu . O-khí ở dạng phân tử không màu. F-khí màu vàng lục nhạt. Al-màu trắng bạc. Si-màu xám sẫm ánh xanh. P-tồn tại dưới ba dạng thù hình cơ bản có màu: trắng, đỏ và đen. S-vàng chanh. Cl-khí màu vàng lục nhạt. Cr-màu trắng bạc. Mn-kim loại màu trắng bạc. Fe-kim loại màu xám nhẹ ánh kim. Cu-kim loại có màu vàng ánh đỏ. Zn-kim loại màu xám nhạt ánh lam. Ba-có màu trắng bạc Hg-Trắng bạc. Pb-trắng xám . Br : đỏ nâu . I : Tinh thể màu tím đen . Mn2+:vàng nhạt. Zn2+:trắng. Al3+:trắng. Ca2+ thì cháy với ngọn lửa màu cam. Na+ thì ngọn lửa màu vàng. K+ ngọn lửa màu tím. Cu2+ có màu xanh lam . Cu1+ có màu đỏ gạch . Fe3+ màu đỏ nâu . Fe2+ màu trắng xanh . Ni2+ lục nhạt . Cr3+ màu lục . Co2+ màu hồng . MnO4- màu tím . CrO4 2- màu vàng . Li+  màu đỏ tía . nhúng Pt vào Li, Ba (các chất cần nhận biết) rồi đem đun nóng trên ngọn lửa ko màu. Li có màu đỏ tía, Ba có màu lục vàng. NO2 : Nâu đỏ H2S : không màu , mùi trứng thối . SO2 : mùi sốc . NO: hóa nâu trong không khí. NH3 : làm quỳ tím ẩm hóa xanh. BẢNG THUỐC THỬ NHẬN BIẾT CÁC HỢP CHẤT VÔ CƠ HÓA CHẤT CÓ ION THUỐC THỬ DẤU HIỆU PHẢN ỨNG Muối clorua, HCl Muối bromua, HBr Muối iotua, HI Cl- Br- I- dd AgNO3 AgCl ¯ trắng AgBr ¯ vàng nhạt AgI ¯ vàng Muối photphat tan (hoặc H3PO4) PO43- dd AgNO3 Ag3PO4 ¯ vàng, tan trong axit mạnh Muối sunfat (tan), axit H2SO4 SO42- ion Ba2+ (BaCl2, Ba(OH)2) BaSO4 ¯ trắng, không tan trong các axit Sunfit, hiđrosunfit, cacbonat, hiđrocacbonat SO32- HSO3- CO32-, HCO3- ion H+ (dd HCl, dd H2SO4, dd HNO3) sủi bọt khí SO2 hoặc CO2 Dd muối sunfua, dd H2S S2- dd có Pb2+, Ag+, Cu2+ :Pb(NO3)2. PbS ¯ đen, CuS ¯ đen (hoặc Ag2S ¯ đen) Muối nitrat (hoặc HNO3) NO3- H2SO4 đặc,Cu,to NO­ không màu sau đó hoá nâu (NO2) , dd sau phản ứng màu xanh lam Muối canxi (tan) Muối bari (tan) Ca2+ Ba2+ Dd có SO32- hoặc CO32-, SO42-,CrO42- (dd Na2CO3) CaSO4 (ít tan), CaCO3¯trắng BaSO4,BaCO3 ¯ trắng, BaCrO4¯ vàng Muối bari (tan) Sr2+ , Ca2+ SO42-, C2O42- SrSO4, SrC2O4¯ trắng, CaC2O4¯ trắng Muối magiê (tan) Mg2+ dd bazơ kiềm: OH– Mg(OH)2 ¯ trắng Muối sắt (II) (tan) Fe2+ NaOH, KOH. (hoặc dd NH3) Fe(OH)2 ¯ lục nhạt (hoặc trắng xanh), hoá nâu đỏ trong không khí Fe(OH)3 Muối sắt (III) (tan) Fe3+ NaOH, KOH. (hoặc dd NH3) Fe(OH)3 ¯ nâu đỏ Muối đồng (tan) (dd màu xanh lam) Cu2+ dd bazơ kiềm NaOH, KOH. (hoặc dd NH3) Cu(OH)2 ¯ xanh lam (tan trong dd NH3 dư) Muối nhôm Al3+ dd bazơ kiềm NaOH, KOH. (hoặc dd NH3) Al(OH)3¯ keo trắng tan trong kiềm dư. (Không tan trong dd NH3 dư) Dd AgNO3 Ag+ OH–, Cl– ¯ nâu đen(Ag2O),¯ trắng(AgCl) Dd muối cađimi Cd2+ OH2–, OH– CdS ¯ vàng, Cd(OH)2¯ trắng Dd muối chì Pb2+ S2– , OH– dư PbS ¯ đen,¯ trắng " tan ra khi OH- dư Dd muối chì Pb2+ Cl–, I– PbCl2 ¯ trắng, PbI2 ¯ vàng Dd muối Hg22+ Hg22+ Cl– Hg2Cl2¯ trắng Dd muối Ni2+ Ni2+ OH– ¯ Ni(OH)2 màu xanh nhạt Dd muối Co2+ Co2+ OH– ¯Co(OH)2màu hồng"Co(OH)3 ¯ màu nâu trong không khí Dd muối Beri Be2+ OH– dư ¯ trắng Be(OH)2 " tan ra Muối amoni NH4+ dd bazơ kiềm NaOH, KOH, to NH3­ mùi khai, làm xanh giấy quì ẩm. Muối kali, natri K+, Na+ ngọn lửa đèn cồn. K: Ngọn lửa màu tím hồng. Na: Ngọn lửa màu vàng. Dd muối nitrit NO2- Dd KMnO4 Mất màu dd thuốc tím Dd muối silicat SiO32- Dd AgNO3, H+ Ag2SiO3, H2SiO3 ¯ keo trắng Dd muối kẽm Zn2+ Dd NH3 hoặc OH– ¯ trắng " tan ra (nếu dư tt) Dd muối Cr2+, Cr3+ Cr2+, Cr3+ Dd NH3 hoặc OH– Cr(OH)2 ¯ vàng, Cr(OH)3 ¯ xám xanh tan trong OH- dư Dd muối Mn2+ Mn2+ Dd NH3 hoặc OH– ¯ trắng Mn(OH)2 SO3 (chất lỏng) Dd có Ba2+ ¯ trắng BaSO4 SO2 (mùi sốc) Dd nước Br2 Dd Ca(OH)2 Mất màu dd nước Br2 ¯ trắng " tan ra(nếu dư SO2) CO2 Dd Ca(OH)2 ¯ trắng " tan ra(nếu dư CO2) Cl2 khí vàng nhạt Quỳ tím ẩm Quỳ tím ẩm chuyển màu hồng I2 chất rắn, tím đen Tinh bột Tính bột " xanh đậm O2 Tàn đóm Tàn đóm cháy sáng H2 Đốt cháy Ngọn lửa xanh, có H2O ngưng tụ H2S mùi trứng thối Giấy tẩm dd Pb(NO3)2 Giấy hoá đen do tạo ra PbS ¯ đen NH3 khí mùi khai Quì tím ẩm Quỳ tím ẩm " màu xanh Khí Cl2 Giấy tẩm hồ tinh bột Làm xanh giấy tẩm hồ tinh bột CO CuO (đen) Chuyển CuO (đen) thành đỏ. Khí HCl - Quỳ tím ẩm ướt - AgNO3 - Quỳ tím ẩm ướt hoá đỏ - Tạo kết tủa trắng Khí N2 Que diêm đỏ Que diêm tắt TỔNG HỢP MỘT SỐ TÍNH CHẤT VẬT LÍ CỦA CÁC KIM LOẠI THƯỜNG GẶP Kim loại Tính chất vật lí Natri (từ tiếng Latinh: natrium; có thể viết là nátri) là tên một nguyên tố hóa học trong bảng tuần hoàn nguyên tố có ký hiệu Navà số nguyên tử bằng 11 Giống như các kim loại kiềm khác, natri là một kim loại mềm, nhẹ, màu trắng bạc, là nguyên tố có phản ứng hóa học mạnh nên không thể tìm thấy ở dạng tự do trong thiên nhiên. Natri nổi trong nước và có phản ứng mãnh liệt với nước, tạo ra hiđrô và các ion hiđrôxít. Nếu được chế thành dạng bột đủ mịn, natri sẽ tự bốc cháy trong nước. Tuy nhiên, nó thông thường không bốc cháy trong không khí có nhiệt độ dưới 388 K (khoảng 115 °C). Ngọn lửa của các hợp chất chứa natri có màu vàng. Natri đã được biết đến trong các hợp chất, nhưng đã không được cô lập cho đến tận năm 1807 khi Humphry Davy điều chế ra nó bằng cách điện phân xút ăn da. Liti (tiếng Hy Lạp: lithos, có nghĩa là "đá") được phát hiện bởiJohann Arfvedson năm 1817 Liti là kim loại nhẹ nhất, có khối lượng riêng lớn hơn một nửa củanước một chút. Giống như các kim loại kiềm khác, liti phản ứng dễ dàng với nước và không có trong tự nhiên ở dạng đơn chất vì tính hoạt động hóa học cao, tuy nhiên nó có tính hoạt động hóa học thấp hơn một chút so với kim loại giống như nó là natri. Khi cho nó vào trong ngọn lửa, kim loại này phát ra ánh sáng màu đỏ thắm, nhưng khi nó cháy mạnh thì ngọn lửa đổi sang màu trắng chói. Liti là kim loại có hóa trị +1. Kali (tên Latinh mới: Kalium) là nguyên tố hoá học ký hiệu K, số thứ tự 19 trong bảng tuần hoàn. Kali là kim loại nhẹ thứ 2 sau liti. Nó là chất rắn mềm có điểm nóng chảy thấp và có thể dùng dao để cắt dễ dàng. Vết cắt tương của kali có màu bạc, nhưng ngay lập tức sẽ lu mờ chuyển sang màu xám sau khi tiếp xúc với không khí, [7][8] nên nó phải được bảo quản trong dầu mỏ hay dầu lửa. Trong thí nghiệm ngọn lửa, kali và các hợp chất của nó phát ra màu hoa cà với đỉnh bức xạ ở bước sóng 766,5 nm. Kali nguyên tố là kim loại kiềm mềm, có màu trắng bạc dễ bị ôxy hóa nhanh trong không khívà phản ứng rất mạnh với nước tạo ra một lượng nhiệt đủ để đốt cháy lượng hyđrô sinh ra trong phản ứng này. Kali cháy có ngọn lửa có màu hoa cà. Xêzi là một nguyên tố hóa học trong bảng tuần hoàn có ký hiệu Csvà số nguyên tử bằng 55. Xêzi (tiếng Latinh caesius có nghĩa là "thiên thanh" hay "lam nhạt") được Robert Bunsen và Gustav Kirchhoff phát hiện nhờ quang phổ năm 1860 trong nước khoáng lấy từ Dürkheim, Đức. Nó là một kim loại kiềm mềm màu vàng ngà với điểm nóng chảy là 28 °C (83 °F), làm cho nó trở thành một trong các kim loại ở dạng lỏng tại hay gần nhiệt độ phòng, cùng với rubidi (39 °C), franxi (27 °C), thủy ngân (-39 °C) và gali (30 °C). Nguyên tố này đáng chú ý nhất là với các ứng dụng trong đồng hồ nguyên tử. Magiê, tiếng Việt còn được đọc là Ma-nhê (Latinh: Magnesium) là tên một nguyên tố hóa học trong bảng tuần hoàn nguyên tố có ký hiệu Mg và số nguyên tử bằng 12. Magiê là kim loại tương đối cứng, màu trắng bạc, nhẹ (chỉ nặng khoảng 2/3 nhôm nếu cùng thể tích) bị xỉn nhẹ đi khi để ngoài không khí. Ở dạng bột, kim loại này bị đốt nóng và bắt lửa khi để vào chỗ ẩm và cháy với ngọn lửa màu trắng. Khi ở dạng tấm dày, nó khó bắt lửa, nhưng khi ở dạng lá mỏng thì nó bắt cháy rất dễ. Khi đã bắt lửa, rất khó dập, nó có thể cháy trong nitơ (tạo ra nitrua magiê) và cả trong điôxít cacbon. Canxi (từ tiếng Latinh: Calcis) là nguyên tố hoá học ký hiệu Ca, số thứ tự 20 trong bảng tuần hoàn. Nó là một kim loại kiềm thổ có nguyên tử khối là 40 Canxi là nguyên tố thiết yếu cho sinh vật sống, đặc biệt trong sinh lý học tế bào, ở đây có sự di chuyển ion Ca2+ vào và ra khỏi tế bào chất có vai trò mang tính hiệu cho nhiều quá trình tế bào. Là một khoáng chất chính trong việc tạo xương, răng và vỏ sò, canxi là kim loại phổ biến nhất về khối lượng có trong nhiều loài động vật.Về hóa học, canxi là một kim loại mềm và phản ứng mạnh (mặc dù cứng hơn chì, nó có thể bị cắt bằng dao một cách khó khăn). Nó là nguyên tố kim loại có màu bạc phải được tách ra bằng phương pháp điện phân từ muối nóng chảy như canxi clorua.[2] Khi được tạo ra, nó nhanh chóng hình thành một lớp áo ôxít và nitrit màu trắng xám do tiếp xúc với không khí. Ở dạng khối, kim loại khó đốt cháy, thậm chí còn khó hơn các miếng magie; nhưng khi cắt ra, kim loại cháy trong không khí cho ngọn lửa cam-đỏ có độ chói cao. Kim loại canxi phản ứng với nước tạo khí hydro với tốc độ nhanh đến mức có thể nhận biết được, nhưng không đủ nhanh ở nhiệt độ phòng để tạo ra nhiều nhiệt, do vậy nên nó rất hữu ích trong việc dùng sản xuất hydro.[3] Tuy nhiên, khi ở dạng bột nó phản ứng với nước cực kỳ nhanh do diện tích bề mặt tiếp xúc tăng do ở dạng bột. Một phần phản ứng với nước bị chậm lại do nó tạo ra sản phẩm không hòa tan là canxi hydroxit có tính bảo vệ. Canxi có tỉ trong 1,55 g/cm3, là kim loại kiềm thổ nhẹ nhất; magie (1,74) và bery (1,84) đặc hơn mặc dù chúng có số khối nhỏ hơn. Kể từ stronti trở đi, các kim loại kiềm thổ có tỷ trọng tăng theo số khối. Canxi có hai đồng hình.[4] Vôi sống (CaO) được sử dụng trong nhiều quy trình làm sạch hóa học và được sản xuất bằng cách nung nóng đá vôi. Khi thêm nước vào vôi sống thì nó tạo ra vôi tôi Ca(OH)2. Khi Ca(OH)2 được trộn với cát nó tạo ra vữa sử dụng trong xây dựng, vữa này cứng lại khi để lâu trong không khí do điôxít cacbon có phản ứng chậm với vôi tôi tạo ra cacbonat canxi. Trộn với các chất khác, chẳng hạn đất sét và thạch cao khi bị nung nóng ở nhiệt độ cao, CaO tạo ra một thành phần quan trọng của xi măng Portland là cờ lanh ke (clinker). Bari (tên Latinh: Barium) là nguyên tố hoá học ký hiệu Ba, số thứ tự 56 trong bảng tuần hoàn Bari (Barium) theo tiếng Hy-Lạp nghĩa là "nặng", được Carl Scheele nhận biết lần đầu tiên vào năm 1774, và được Humphry Davy cô lập vào năm 1808 tại Anh. Bari là kim loại kiềm thổ có tính chất hóa học tương tự canxi. Ở dạng tinh khiết, nó có màu trắng bạc như chì. Nó kết tinh theo kiểu ô mạng lập phương tâm khối. Kim loại này bị ôxi hóa rất dễ dàng trong không khí[1] và phản ứng mãnh liệt với nước hoặc cồn. Một số hợp chất của nguyên tố này có trọng lượng riêng lớn, chẳng hạn như BaSO4 (bari sulfat), hay còn gọi là khoáng spat. Khi cháy nó cho ra ngọn lửa màu lục hoặc lục nhạt và phát ra bước sóng 524.2 và 513.7 nm. Bari là một chất rắn, màu trắng bạc, và nóng chảy ở nhiệt độ rất cao. Ôxít của nó được gọi là baryta và được tìm thấy chủ yếu trong quặng barít, nhưng bari chưa bao giờ được tìm thấy ở dạng tinh khiết do bị ôxi hóa trong không khí. Các hợp chất của kim loại này được sử dụng với số lượng nhỏ trong sơn và trong sản xuất thủy tinh. Nhôm (tiếng Latinh: alumen, alum) là tên một nguyên tố hóa học trong bảng tuần hoàn nguyên tố có ký hiệu Al và số nguyên tử bằng 13. Nhôm là một kim loại mềm, nhẹ với màu xám bạc ánh kim mờ, vì có một lớp mỏng ôxi hóa tạo thành rất nhanh khi nó để trần ngoàikhông khí. Tỷ trọng riêng của nhôm chỉ khoảng một phần ba sắt hay đồng; nó rất mềm (chỉ sau vàng), dễ uốn (đứng thứ sáu) và dễ dàng gia công trên máy móc hay đúc; nó có khả năng chống ăn mòn và bền vững do lớp ôxít bảo vệ. Nó cũng không nhiễm từ và không cháy khi để ở ngoài không khí ở điều kiện thông thường. Nhôm có điểm đáng chú ý của một kim loại có tỷ trọng thấp và có khả năng chống ăn mòn hiện tượng thụ động. Các thành phần cấu trúc được làm từ nhôm và hợp kim của nó là rất quan trọng cho ngành công nghiệp hàng không vũ trụ và rất quan trọng trong các lĩnh vực khác của giao thông vận tải và vật liệu cấu trúc. Các hợp chất hữu ích nhất của nhôm là các ôxít và sunfat. Nguyên tử khối bằng 27 đvC. Khối lượng riêng là 2,7 g/cm3. Nhiệt độ nóng chảy là 660oC. Nhôm là nguyên tố phổ biến thứ 3 (sau ôxy và silic), và là kim loại phổ biến nhất trong vỏ Trái Đất. Nhôm chiếm khoảng 8% khối lớp rắn của Trái Đất. Kim loại nhôm hiếm phản ứng hóa học mạnh với các mẫu quặng và có mặt hạn chế trong các môi trường khử cực mạnh. Tuy vậy, nó vẫn được tìm thấy ở dạng hợp chất trong hơn 270 loại khoáng vật khác nhau.[4] Quặng chính chứa nhôm là bô xít. Từ "nhôm" trong tiếng Việt có nguồn gốc từ aluminium trong tiếng Pháp. Crom hay crôm (tiếng La tinh: Chromium) là một nguyên tố hóa học trong bảng tuần hoàn có ký hiệu Cr và số nguyên tử bằng 24. Crom là một kim loại cứng, mặt bóng, màu xám thép với độ bóng cao và nhiệt độ nóng chảy cao. Nó là chất không mùi, không vị và dễ rèn. Các trạng thái ôxi hóa phổ biến của crom là +2, +3 và +6, với +3 là ổn định nhất. Các trạng thái +1, +4 và +5 là khá hiếm. Các hợp chất của crom với trạng thái ôxi hóa +6 là những chất có tính ôxi hóa mạnh. Trong không khí, crom được ôxy thụ động hóa, tạo thành một lớp mỏng ôxít bảo vệ trên bề mặt, ngăn chặn quá trình ôxi hóa tiếp theo đối với kim loại ở phía dưới. Crom được đặt tên theo một từ trong tiếng Hy Lạp là "chroma" có nghĩa là màu sắc, do nhiều hợp chất với màu sắc đa dạng được làm ra từ nó. Vào ngày 26 tháng 7 năm 1761, Johann Gottlob Lehmann đã tìm thấy một khoáng chất màu đỏ da cam tại khu vực thuộc dãy núi Ural và ông đặt tên cho nó là chì đỏ Siberi Sắt là tên một nguyên tố hóa học trong bảng tuần hoàn nguyên tố có ký hiệu Fe và số hiệu nguyên tử bằng 26.  Nằm ở phân nhóm VIIIB chu kỳ 4. Sắt, Côban (Co) và Niken (Ni) được biết là 2 nguyên tố cuối cùng có thể tạo thành qua tổng hợp ở nhân sao(hình thành qua phản ứng hạt nhân ở tâm các vì sao) mà không cần phải qua một vụ nổ siêu tân tinh hay các biến động lớn khác. Do đó sắt và Niken khá dồi dào trong các thiên thạch kim loại và các hành tinh lõi đá (như Trái Đất, Sao Hỏa) Một nguyên tử sắt điển hình có khối lượng gấp 56 lần khối lượng một nguyên tử hiđrô điển hình. Sắt là kim loại phổ biến nhất, và người ta cho rằng nó là nguyên tố phổ biến thứ 10 trongvũ trụ. Sắt cũng là nguyên tố phổ biến nhất (theo khối lượng, 34,6%) tạo ra Trái Đất; sự tập trung của sắt trong các lớp khác nhau của Trái Đất dao động từ rất cao ở lõi bên trong tới khoảng 5% ở lớp vỏ bên ngoài; có thể phần lõi của Trái Đất chứa cáctinh thể sắt mặc dù nhiều khả năng là hỗn hợp của sắt và niken; một khối lượng lớn của sắt trong Trái Đất được coi là tạo ra từ trường của nó. Ký hiệu của sắt Fe là từ viết tắt của ferrum, từLatinh để chỉ sắt. Sắt là kim loại được tách ra từ các mỏ quặng sắt, và rất khó tìm thấy nó ở dạng tự do. Để thu được sắt tự do, các tạp chất phải được loại bỏ bằng phương pháp khử hóa học. Sắt được sử dụng trong sản xuất gang và thép, đây là các hợp kim, là sự hòa tan của các kim loại khác (và một số á kim hay phi kim, đặc biệt là cacbon). Hạt nhân của sắt có năng lượng liên kết cao nhất, vì thế nó là nguyên tố nặng nhất được sản xuất trong các phản ứng nhiệt hạch và là nhẹ nhất trong phản ứng phân rã hạt nhân. Các ngôi sao có khối lượng lớn khi gần cháy hết nhiên liệu hiđrô, sẽ bắt đầu các chuỗi phản ứng hạt nhân tạo ra các chất có khối lượngnguyên tử tăng dần, bao gồm cả sắt, trước khi bùng nổ thành các siêu tân tinh. Các mô hình vũ trụ trong vũ trụ mở dự đoán rằng có một giai đoạn ở đó do kết quả của các phản ứng nhiệt hạch và phân hạch chậm lại, mọi thứ sẽ trở thành sắt. Đồng là nguyên tố hóa học trong bảng tuần hoàn nguyên tố có ký hiệu Cu và số nguyên tử bằng 29. Đồng là kim loại dẻo có độ dẫn điện và dẫn nhiệt cao. Đồng nguyên chất mềm và dễ uốn; bề mặt đồng tươi có màu cam đỏ. Nó được sử dụng làm chất dẫn nhiệt và điện, vật liệu xây dựng, và thành phần của các hợp kim của nhiều kim loại khác nhau. Kim loại và các hợp kim của nó đã được sử dụng cách đây hàng ngàn năm. Trong thời kỳ La Mã, đồng chủ yếu được khai thác ởSíp, vì thế tên gọi ban đầu của kim loại này là сyprium (kim loại Síp), sau đó được gọi tắt là сuprum. Các hợp chất của nó thường tồn tại ở dạng muối đồng(II), chúng thường có màu xanh lam hoặc xanh lục của các loại khoáng như ngọc lam và trong lịch sử đã được sử dụng rộng rãi làm chất nhuộm. Các công trình kiến trúc được xây dựng có đồng bị ăn mòn tạo ra màu xanh lục verdigris(hoặc patina). Trái ngược với các kim loại mà phân lớp d không được lấp đầu bởi các electron, các liên kết kim loại trong đồng thiếu các đặc điểm của liên kết cộng hóa trị và chúng tương đối yếu. Điều này giải thích tại sao các tinh thể đồng riêng biệt có độ dẻo cao và độ cứng thấp.[1] Ở quy mô lớn, việc thêm vào các khuyết tật trong ô mạng tinh thể như ranh giới hạt, sẽ làm cản trở dòng vật liệu dưới áp lực nén từ đó làm tăng độ cứng của nó TÀI LIỆU ÔN THI TỐT NGHIỆP THPT TRẦN THANH TÂN 12A1

Các file đính kèm theo tài liệu này:

  • docon_tap_hoa_0284.doc
Tài liệu liên quan